6-(6-fluoro-1H-indol-3-yl)-1-(piperazin-1-ylmethyl)-1H-benzo[d][1,2,3]triazole

ID: ALA4875970

PubChem CID: 164625965

Max Phase: Preclinical

Molecular Formula: C20H21FN6

Molecular Weight: 364.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1ccc2c(-c3ccc4nnn(CCN5CCNCC5)c4c3)c[nH]c2c1

Standard InChI:  InChI=1S/C20H21FN6/c21-15-2-3-16-17(13-23-19(16)12-15)14-1-4-18-20(11-14)27(25-24-18)10-9-26-7-5-22-6-8-26/h1-4,11-13,22-23H,5-10H2

Standard InChI Key:  NWBMXBXPSXUWBK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
   29.5619  -13.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5608  -14.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2688  -15.1001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2670  -13.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9757  -13.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9804  -14.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7605  -14.9350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2378  -14.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7527  -13.6105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0007  -12.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8008  -12.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6964  -11.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4520  -12.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5008  -11.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0460  -11.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7905  -11.5506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7055  -10.7401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9084  -10.5706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4981  -11.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4979  -12.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2055  -13.1853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2031  -14.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9066  -14.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6168  -14.0040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6190  -13.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9109  -12.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8527  -15.0992    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
  2 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875970

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.43Molecular Weight (Monoisotopic): 364.1812AlogP: 2.62#Rotatable Bonds: 4
Polar Surface Area: 61.77Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.24CX LogP: 2.80CX LogD: 0.96
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.58Np Likeness Score: -1.54

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source