The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-methyl-3-(3-(4-sulfamoylphenethyl)ureido)pyrazolo[1,5-a]pyrimidine-6-carboxylic acid ID: ALA4875979
PubChem CID: 164626349
Max Phase: Preclinical
Molecular Formula: C17H18N6O5S
Molecular Weight: 418.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)O)cnc2c(NC(=O)NCCc3ccc(S(N)(=O)=O)cc3)cnn12
Standard InChI: InChI=1S/C17H18N6O5S/c1-10-13(16(24)25)8-20-15-14(9-21-23(10)15)22-17(26)19-7-6-11-2-4-12(5-3-11)29(18,27)28/h2-5,8-9H,6-7H2,1H3,(H,24,25)(H2,18,27,28)(H2,19,22,26)
Standard InChI Key: NMDVARAMHFVDHU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
20.7435 -1.9315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5359 -1.7211 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.9574 -1.1400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8796 -10.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5849 -10.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2902 -10.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2902 -9.4142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8774 -9.4103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5849 -9.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4148 -8.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6020 -8.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2699 -8.8637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1731 -10.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5849 -11.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8772 -11.8617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2926 -11.8617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9614 -7.5947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7086 -6.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2553 -6.2101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9092 -6.6480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0025 -5.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5491 -4.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2963 -4.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8440 -3.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5918 -2.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7916 -2.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2441 -3.1111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4992 -3.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0836 -1.1138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
4 13 1 0
5 14 1 0
14 15 2 0
14 16 1 0
10 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 2 1 0
2 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.44Molecular Weight (Monoisotopic): 418.1059AlogP: 0.75#Rotatable Bonds: 6Polar Surface Area: 168.78Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.46CX Basic pKa: 0.59CX LogP: 0.26CX LogD: -3.13Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -1.83
References 1. Gumus A, Bozdag M, Angeli A, Peat TS, Carta F, Supuran CT, Selleri S.. (2021) Privileged scaffolds in medicinal chemistry: Studies on pyrazolo[1,5-a]pyrimidines on sulfonamide containing Carbonic Anhydrase inhibitors., 49 [PMID:34371130 ] [10.1016/j.bmcl.2021.128309 ]