N,N-dimethyl-4-(3-(pyridin-4-ylmethyl)ureido)benzenesulfonamide

ID: ALA4876062

PubChem CID: 135222744

Max Phase: Preclinical

Molecular Formula: C15H18N4O3S

Molecular Weight: 334.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)S(=O)(=O)c1ccc(NC(=O)NCc2ccncc2)cc1

Standard InChI:  InChI=1S/C15H18N4O3S/c1-19(2)23(21,22)14-5-3-13(4-6-14)18-15(20)17-11-12-7-9-16-10-8-12/h3-10H,11H2,1-2H3,(H2,17,18,20)

Standard InChI Key:  ZNLVTZJKIYFCOJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    8.3508   -2.5351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2268   -1.4198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6395   -2.1296    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.0479   -1.4173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5764   -3.7888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5753   -4.6083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2833   -5.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9930   -4.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9901   -3.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2815   -3.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6963   -3.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4055   -3.7798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1117   -3.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8209   -3.7745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5271   -3.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1086   -2.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2324   -3.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9380   -3.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9354   -2.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2212   -2.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5184   -2.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0562   -2.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3553   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 15  1  0
 19  3  1  0
  3  1  1  0
  1 22  1  0
  1 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876062

    ---

Associated Targets(Human)

NAMPT Tchem Nicotinamide phosphoribosyltransferase (3221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 334.40Molecular Weight (Monoisotopic): 334.1100AlogP: 1.65#Rotatable Bonds: 5
Polar Surface Area: 91.40Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.67CX Basic pKa: 5.02CX LogP: 0.66CX LogD: 0.66
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.87Np Likeness Score: -2.21

References

1. Pinkerton AB, Sessions EH, Hershberger P, Maloney PR, Peddibhotla S, Hopf M, Sergienko E, Ma CT, Smith LH, Jackson MR, Tanaka J, Tsuji T, Akiu M, Cohen SE, Nakamura T, Gardell SJ..  (2021)  Optimization of a urea-containing series of nicotinamide phosphoribosyltransferase (NAMPT) activators.,  41  [PMID:33798699] [10.1016/j.bmcl.2021.128007]

Source