(E)-8-(4-(dimethylamino)but-2-enoyl)-2-(4-phenoxyphenyl)-6,7,8,9-tetrahydro-1H-imidazo[1',2':1,5]pyrazolo[4,3-c]pyridine-3-carboxamide

ID: ALA4876114

PubChem CID: 163473377

Max Phase: Preclinical

Molecular Formula: C27H28N6O3

Molecular Weight: 484.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)C/C=C/C(=O)N1CCc2nn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)[nH]c3c2C1

Standard InChI:  InChI=1S/C27H28N6O3/c1-31(2)15-6-9-23(34)32-16-14-22-21(17-32)27-29-24(25(26(28)35)33(27)30-22)18-10-12-20(13-11-18)36-19-7-4-3-5-8-19/h3-13,29H,14-17H2,1-2H3,(H2,28,35)/b9-6+

Standard InChI Key:  BYKVXOMUFGIIKS-RMKNXTFCSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   15.7771  -14.2635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0334  -13.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3655  -12.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9496  -14.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6946  -13.4796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8700  -13.4811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3639  -12.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6460  -11.7489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0762  -11.7463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8173  -13.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4324  -13.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2194  -13.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3923  -12.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7721  -12.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9917  -12.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1796  -12.4583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7955  -13.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6204  -13.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2315  -14.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0197  -14.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1934  -13.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5768  -12.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2826  -14.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6154  -14.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8681  -14.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7817  -15.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4488  -15.9039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2024  -15.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3636  -16.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6118  -17.0586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0303  -17.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9452  -18.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6118  -18.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5267  -19.3272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1934  -19.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7749  -19.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  2  0
  3  5  1  0
  4  5  1  0
  5  6  1  0
  6 24  2  0
 23  4  2  0
  3  7  1  0
  7  8  2  0
  7  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  2 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  2  0
 29 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876114

    ---

Associated Targets(Human)

BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.56Molecular Weight (Monoisotopic): 484.2223AlogP: 3.22#Rotatable Bonds: 7
Polar Surface Area: 108.96Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.49CX Basic pKa: 8.81CX LogP: 2.51CX LogD: 1.09
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.81

References

1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q..  (2021)  Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase.,  225  [PMID:34391034] [10.1016/j.ejmech.2021.113724]

Source