The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(dimethylamino)-2-oxoethyl 4'-(piperidin-4-yl)-5-(4-(4-(trifluoromethyl)phenyl)-1H-1,2,3-triazol-1-yl)biphenyl-3-carboxylate ID: ALA4876134
PubChem CID: 164585643
Max Phase: Preclinical
Molecular Formula: C31H30F3N5O3
Molecular Weight: 577.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)COC(=O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3ccc(C(F)(F)F)cc3)nn2)c1
Standard InChI: InChI=1S/C31H30F3N5O3/c1-38(2)29(40)19-42-30(41)25-15-24(21-5-3-20(4-6-21)22-11-13-35-14-12-22)16-27(17-25)39-18-28(36-37-39)23-7-9-26(10-8-23)31(32,33)34/h3-10,15-18,22,35H,11-14,19H2,1-2H3
Standard InChI Key: BQVLEVOZIQNTJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
7.0467 -4.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3419 -4.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8278 -3.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2418 -4.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7258 -4.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0191 -3.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5038 -2.9644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1492 -3.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6626 -4.6119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4431 -3.2136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9528 -5.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1447 -5.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8536 -6.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3697 -7.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1802 -7.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4675 -6.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7166 -2.1781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0306 -1.7341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3963 -2.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6905 -3.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6067 -2.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3958 -1.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6069 -1.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0291 -1.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2456 -2.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0340 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2391 -1.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0253 -0.6198 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.6630 -1.9881 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.4457 -1.1928 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0797 -8.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2719 -8.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9814 -8.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4950 -9.5703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3029 -9.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5972 -8.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2504 -3.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5442 -2.3244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3515 -2.1976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6454 -1.4351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8650 -2.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0308 -1.6886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
2 8 1 0
8 9 2 0
8 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
4 11 1 0
7 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 7 1 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
14 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
10 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
38 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.61Molecular Weight (Monoisotopic): 577.2301AlogP: 5.33#Rotatable Bonds: 7Polar Surface Area: 89.35Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.06CX LogP: 5.46CX LogD: 2.90Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.30Np Likeness Score: -1.32
References 1. Jung YH, Salmaso V, Wen Z, Bennett JM, Phung NB, Lieberman DI, Gopinatth V, Randle JCR, Chen Z, Salvemini D, Karcz TP, Cook DN, Jacobson KA.. (2021) Structure-Activity Relationship of Heterocyclic P2Y14 Receptor Antagonists: Removal of the Zwitterionic Character with Piperidine Bioisosteres., 64 (8.0): [PMID:33787273 ] [10.1021/acs.jmedchem.1c00164 ]