3-Ethyl-N-(2-((2-oxo-2-(((S)-1-phenylethyl)amino)ethyl)thio)benzo[d]thiazol-6-yl)-4-(pentan-2-yloxy)benzamide

ID: ALA4876198

PubChem CID: 164625738

Max Phase: Preclinical

Molecular Formula: C31H35N3O3S2

Molecular Weight: 561.77

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)cc1CC

Standard InChI:  InChI=1S/C31H35N3O3S2/c1-5-10-20(3)37-27-16-13-24(17-22(27)6-2)30(36)33-25-14-15-26-28(18-25)39-31(34-26)38-19-29(35)32-21(4)23-11-8-7-9-12-23/h7-9,11-18,20-21H,5-6,10,19H2,1-4H3,(H,32,35)(H,33,36)/t20?,21-/m0/s1

Standard InChI Key:  NGXMDBDZFFSVJS-LBAQZLPGSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    2.9248  -26.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9236  -27.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6317  -27.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3455  -27.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3426  -26.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6299  -26.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6275  -25.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3381  -25.0746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9185  -25.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0511  -25.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7617  -25.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4748  -25.4810    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.1854  -25.0662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9336  -25.3971    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.2650  -24.2458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0679  -24.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4744  -24.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2920  -24.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7042  -24.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2886  -23.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4723  -23.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5255  -24.0740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9349  -24.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7563  -24.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1662  -25.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9868  -25.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3953  -24.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9814  -24.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1622  -24.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2166  -24.7830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0536  -26.3066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5272  -25.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6270  -25.4897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4442  -25.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2202  -26.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8546  -26.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6718  -26.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3876  -23.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2048  -23.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  6
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 17  1  0
 16 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 10 31  2  0
 23 32  2  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 34 36  1  0
 36 37  1  0
 28 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876198

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 561.77Molecular Weight (Monoisotopic): 561.2120AlogP: 7.65#Rotatable Bonds: 12
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.64CX Basic pKa: 1.07CX LogP: 7.78CX LogD: 7.78
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.17Np Likeness Score: -1.86

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source