2-(3-((2,2-difluorocyclopropyl)methoxy)-1,4'-bipiperidin-1'-yl)-N-((3,5-difluoropyridin-2-yl)methyl)thiazole-5-carboxamide

ID: ALA4876214

PubChem CID: 156735115

Max Phase: Preclinical

Molecular Formula: C24H29F4N5O2S

Molecular Weight: 527.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1ncc(F)cc1F)c1cnc(N2CCC(N3CCCC(OCC4CC4(F)F)C3)CC2)s1

Standard InChI:  InChI=1S/C24H29F4N5O2S/c25-16-8-19(26)20(29-10-16)11-30-22(34)21-12-31-23(36-21)32-6-3-17(4-7-32)33-5-1-2-18(13-33)35-14-15-9-24(15,27)28/h8,10,12,15,17-18H,1-7,9,11,13-14H2,(H,30,34)

Standard InChI Key:  YAJMPZFDYPOFQB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   28.6430   -2.6125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.0652   -3.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8580   -3.4039    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.8802   -6.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8790   -6.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5871   -7.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2967   -6.8819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2939   -6.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5853   -5.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5828   -4.8368    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.1710   -7.2904    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.0001   -5.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7093   -6.0539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4155   -5.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1247   -6.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4124   -4.8255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2110   -6.8608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0110   -7.0277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4170   -6.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8678   -5.7133    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.2293   -6.2298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7126   -6.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5216   -6.8069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8551   -6.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3733   -5.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5579   -5.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6678   -5.9750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1449   -6.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9542   -6.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2905   -5.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8112   -5.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9955   -5.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1461   -4.4046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9591   -4.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3635   -3.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3585   -2.7937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
  5 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  1  0
 19 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
  2 35  1  0
 36  2  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876214

    ---

Associated Targets(Human)

ADRA2C Tclin Alpha-2c adrenergic receptor (4876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.59Molecular Weight (Monoisotopic): 527.1978AlogP: 3.85#Rotatable Bonds: 8
Polar Surface Area: 70.59Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.88CX Basic pKa: 8.63CX LogP: 2.59CX LogD: 1.34
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.53Np Likeness Score: -1.32

References

1. Sabnis RW..  (2021)  Novel Substituted Heterocyclic Carboxamides as Adrenoreceptor ADRAC2 Inhibitors for Treating Diseases.,  12  (9.0): [PMID:34531943] [10.1021/acsmedchemlett.1c00423]

Source