The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-(2-hydroxyphenyl)piperazin-1-yl)-8-(thiophen-2-yl)isothiochromane-5-carbonitrile ID: ALA4876232
PubChem CID: 164626188
Max Phase: Preclinical
Molecular Formula: C24H23N3OS2
Molecular Weight: 433.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1c(N2CCN(c3ccccc3O)CC2)cc(-c2cccs2)c2c1CCSC2
Standard InChI: InChI=1S/C24H23N3OS2/c25-15-19-17-7-13-29-16-20(17)18(24-6-3-12-30-24)14-22(19)27-10-8-26(9-11-27)21-4-1-2-5-23(21)28/h1-6,12,14,28H,7-11,13,16H2
Standard InChI Key: NVSWVTURNDWPPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
22.5502 -6.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8449 -5.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1397 -7.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1351 -6.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8480 -4.9774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2591 -5.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9680 -5.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5644 -4.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5694 -3.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8651 -3.3443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1541 -3.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1473 -4.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8713 -2.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5838 -2.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5903 -1.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8852 -0.8962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1720 -1.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1690 -2.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2873 -2.5431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4363 -7.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6884 -7.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1440 -7.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5555 -8.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3541 -8.2536 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.5575 -7.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8452 -7.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8391 -8.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5435 -8.6603 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.2558 -8.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2636 -7.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 26 1 0
25 1 1 0
1 2 2 0
3 4 2 0
2 5 1 0
1 6 1 0
6 7 3 0
5 8 1 0
5 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
14 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
3 20 1 0
25 26 2 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.60Molecular Weight (Monoisotopic): 433.1283AlogP: 5.11#Rotatable Bonds: 3Polar Surface Area: 50.50Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.20CX Basic pKa: 2.20CX LogP: 5.60CX LogD: 5.60Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: -1.17
References 1. Mishra S, Parmar N, Chandrakar P, Sharma CP, Parveen S, Vats RP, Seth A, Goel A, Kar S.. (2021) Design, synthesis, in vitro and in vivo biological evaluation of pyranone-piperazine analogs as potent antileishmanial agents., 221 [PMID:33992928 ] [10.1016/j.ejmech.2021.113516 ]