6-Benzyl-N4-((1r,3r)-3-hydroxycyclobutyl)-N2-methylpyridine-2,4-dicarboxamide

ID: ALA4876311

PubChem CID: 132167406

Max Phase: Preclinical

Molecular Formula: C19H21N3O3

Molecular Weight: 339.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cc(C(=O)N[C@H]2C[C@H](O)C2)cc(Cc2ccccc2)n1

Standard InChI:  InChI=1S/C19H21N3O3/c1-20-19(25)17-9-13(18(24)22-15-10-16(23)11-15)8-14(21-17)7-12-5-3-2-4-6-12/h2-6,8-9,15-16,23H,7,10-11H2,1H3,(H,20,25)(H,22,24)/t15-,16-

Standard InChI Key:  FQRNJZDJWMGBEX-WKILWMFISA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    5.0343  -27.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3290  -27.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3290  -26.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0367  -25.8860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6213  -25.8860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7444  -26.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6237  -27.5245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6237  -28.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3290  -28.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0343  -28.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9166  -28.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2083  -28.3437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2101  -27.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5026  -27.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7945  -27.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7983  -28.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5064  -28.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7414  -28.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7402  -29.5685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4497  -28.3437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1568  -28.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3660  -29.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1557  -29.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9453  -28.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8628  -29.7390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  2  7  1  0
  1 10  1  0
 10 18  1  0
 18 19  2  0
 18 20  1  0
 21 20  1  6
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 21  1  0
 23 25  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4876311

    ---

Associated Targets(Human)

BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 339.40Molecular Weight (Monoisotopic): 339.1583AlogP: 1.29#Rotatable Bonds: 5
Polar Surface Area: 91.32Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.60CX Basic pKa: 0.37CX LogP: 0.63CX LogD: 0.63
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.77Np Likeness Score: -0.40

References

1. Harrison LA, Atkinson SJ, Bassil A, Chung CW, Grandi P, Gray JRJ, Levernier E, Lewis A, Lugo D, Messenger C, Michon AM, Mitchell DJ, Preston A, Prinjha RK, Rioja I, Seal JT, Taylor S, Wall ID, Watson RJ, Woolven JM, Demont EH..  (2021)  Identification of a Series of N-Methylpyridine-2-carboxamides as Potent and Selective Inhibitors of the Second Bromodomain (BD2) of the Bromo and Extra Terminal Domain (BET) Proteins.,  64  (15.0): [PMID:34232650] [10.1021/acs.jmedchem.0c02155]

Source