The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-acryloylpiperazin-1-yl)-6-chloro-7-(2-fluorophenyl)-1-(2-isopropyl-4-methylpyridin-3-yl)-2-oxo-1,2-dihydro-1,8-naphthyridine-3-carbonitrile ID: ALA4876344
PubChem CID: 152795064
Max Phase: Preclinical
Molecular Formula: C31H28ClFN6O2
Molecular Weight: 571.06
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCN(c2c(C#N)c(=O)n(-c3c(C)ccnc3C(C)C)c3nc(-c4ccccc4F)c(Cl)cc23)CC1
Standard InChI: InChI=1S/C31H28ClFN6O2/c1-5-25(40)37-12-14-38(15-13-37)29-21-16-23(32)27(20-8-6-7-9-24(20)33)36-30(21)39(31(41)22(29)17-34)28-19(4)10-11-35-26(28)18(2)3/h5-11,16,18H,1,12-15H2,2-4H3
Standard InChI Key: SLDPJSSOJWLRRP-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
22.8677 -20.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8665 -21.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5746 -21.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2842 -21.0939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2814 -20.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5728 -19.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3346 -18.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3335 -19.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0415 -19.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7512 -19.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7484 -18.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0398 -18.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4596 -19.6381 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.4545 -17.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1611 -18.4056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1499 -16.7712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4471 -17.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7360 -16.7815 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.8641 -17.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8647 -17.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5692 -18.4008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2777 -17.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2771 -17.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5681 -16.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9851 -18.4028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1599 -19.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9876 -19.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6968 -20.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9845 -19.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9807 -16.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6886 -16.3581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5664 -15.9482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2806 -15.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2809 -14.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5741 -14.3166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8655 -14.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8635 -15.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5755 -13.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2839 -13.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8685 -13.0896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2853 -12.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
11 14 1 0
14 15 2 0
15 20 1 0
19 16 1 0
16 17 2 0
17 14 1 0
17 18 1 0
19 20 2 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
22 25 2 0
21 6 1 0
1 26 1 0
5 27 1 0
27 28 1 0
27 29 1 0
30 31 3 0
23 30 1 0
24 32 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
35 38 1 0
38 39 1 0
38 40 2 0
39 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 571.06Molecular Weight (Monoisotopic): 570.1946AlogP: 5.38#Rotatable Bonds: 5Polar Surface Area: 95.12Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.54CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -1.02