2-(4-chloro-3-fluorophenyl)-N-((1-(3-chlorophenyl)-3-(trifluoromethyl)-1H-pyrazol-5-yl)methyl)propanamide

ID: ALA4876351

PubChem CID: 164628872

Max Phase: Preclinical

Molecular Formula: C20H15Cl2F4N3O

Molecular Weight: 460.26

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C(=O)NCc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1)c1ccc(Cl)c(F)c1

Standard InChI:  InChI=1S/C20H15Cl2F4N3O/c1-11(12-5-6-16(22)17(23)7-12)19(30)27-10-15-9-18(20(24,25)26)28-29(15)14-4-2-3-13(21)8-14/h2-9,11H,10H2,1H3,(H,27,30)

Standard InChI Key:  IWTFRLHOMONHCF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    0.6199  -13.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4426  -14.1316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0531  -14.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8410  -14.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0152  -13.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4033  -13.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4522  -14.9902    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.5766  -12.2652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3254  -11.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2410  -11.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4344  -10.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0205  -11.6488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1004  -10.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5867   -9.5144    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.2802  -10.0928    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8435   -9.3892    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.0401  -12.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7544  -11.9286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4690  -12.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1833  -11.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4693  -13.1658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8979  -12.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8952  -13.1636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6089  -13.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3243  -13.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3213  -12.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6069  -11.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0341  -11.9185    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.0395  -13.5742    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.1830  -11.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
  9 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 26 28  1  0
 25 29  1  0
 20 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876351

    ---

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.26Molecular Weight (Monoisotopic): 459.0528AlogP: 5.76#Rotatable Bonds: 5
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.57CX Basic pKa: CX LogP: 5.92CX LogD: 5.92
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -1.89

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source