5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-((4-(4-methylbenzyl)piperazin-1-yl)meth-yl)-4H-chromen-4-one

ID: ALA4876352

PubChem CID: 164628873

Max Phase: Preclinical

Molecular Formula: C28H28N2O5

Molecular Weight: 472.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(CN2CCN(Cc3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)CC2)cc1

Standard InChI:  InChI=1S/C28H28N2O5/c1-18-2-4-19(5-3-18)16-29-10-12-30(13-11-29)17-22-23(32)14-24(33)27-25(34)15-26(35-28(22)27)20-6-8-21(31)9-7-20/h2-9,14-15,31-33H,10-13,16-17H2,1H3

Standard InChI Key:  ZCDYIXTZSZFBSI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   33.4311  -21.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4300  -22.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1445  -22.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1428  -20.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8579  -21.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8567  -22.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5733  -22.6566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2956  -22.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2968  -21.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5757  -20.9911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7168  -21.0001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1443  -23.4767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5709  -23.4812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1403  -20.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4249  -19.7648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4251  -18.9366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7137  -18.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9983  -18.9375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9988  -19.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7147  -20.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2844  -18.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5700  -18.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0103  -21.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7238  -21.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4385  -21.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4410  -20.1831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7228  -19.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0110  -20.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1556  -19.7716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8576  -18.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1452  -18.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1403  -19.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8540  -20.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5726  -19.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4242  -20.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 11  1  0
  3 12  1  0
  7 13  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  9 23  1  0
 26 29  1  0
 22 30  2  0
 22 34  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876352

    ---

Associated Targets(Human)

PARP1 Tclin Poly [ADP-ribose] polymerase-1 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PARP2 Tclin Poly [ADP-ribose] polymerase 2 (1185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.54Molecular Weight (Monoisotopic): 472.1998AlogP: 4.20#Rotatable Bonds: 5
Polar Surface Area: 97.38Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.68CX Basic pKa: 6.90CX LogP: 3.63CX LogD: 3.21
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: 0.26

References

1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H..  (2021)  Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer.,  64  (16.0): [PMID:34404206] [10.1021/acs.jmedchem.1c00735]

Source