N-(2-methyl-3-phenylallylidene)-4-(2-(2-methyl-3-phenylallylidene)hydrazinyl)benzenesulfonamide

ID: ALA4876358

PubChem CID: 164628877

Max Phase: Preclinical

Molecular Formula: C26H25N3O2S

Molecular Weight: 443.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(/C=N/Nc1ccc(S(=O)(=O)/N=C/C(C)=C/c2ccccc2)cc1)=C\c1ccccc1

Standard InChI:  InChI=1S/C26H25N3O2S/c1-21(17-23-9-5-3-6-10-23)19-27-29-25-13-15-26(16-14-25)32(30,31)28-20-22(2)18-24-11-7-4-8-12-24/h3-20,29H,1-2H3/b21-17+,22-18+,27-19+,28-20+

Standard InChI Key:  NVBCYDGOABSMGL-YMAQYZRWSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    6.4674  -20.0666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0629  -19.3608    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6539  -20.0640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7755  -18.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7743  -18.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4824  -19.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1921  -18.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1892  -18.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4806  -17.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8954  -17.7201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8923  -16.9030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5985  -16.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5954  -15.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3016  -15.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8862  -15.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2985  -14.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0068  -14.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0041  -13.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2943  -12.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5858  -13.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5920  -14.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3589  -18.9534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6509  -19.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9435  -18.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2355  -19.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9442  -18.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5281  -18.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5337  -18.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8272  -17.7269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1182  -18.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1201  -18.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8273  -19.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  5  2  1  0
  2 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876358

    ---

Associated Targets(Human)

PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.57Molecular Weight (Monoisotopic): 443.1667AlogP: 6.05#Rotatable Bonds: 8
Polar Surface Area: 70.89Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.84CX LogP: 6.05CX LogD: 6.04
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -0.76

References

1. Almahmoud S, Elix CC, Jones JO, Hopkins CR, Vennerstrom JL, Zhong HA..  (2021)  Virtual screening and biological evaluation of PPARγ antagonists as potential anti-prostate cancer agents.,  46  [PMID:34433102] [10.1016/j.bmc.2021.116368]

Source