cis-4-((5-Cyano-2-(((4-(trifluoromethylpyridin-3-yl)methyl)-amino)pyridin-4-yl)amino)-N-methylcyclohexane-1-carboxamide

ID: ALA4876360

PubChem CID: 164628878

Max Phase: Preclinical

Molecular Formula: C21H23F3N6O

Molecular Weight: 432.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)[C@H]1CC[C@@H](Nc2cc(NCc3cnccc3C(F)(F)F)ncc2C#N)CC1

Standard InChI:  InChI=1S/C21H23F3N6O/c1-26-20(31)13-2-4-16(5-3-13)30-18-8-19(28-11-14(18)9-25)29-12-15-10-27-7-6-17(15)21(22,23)24/h6-8,10-11,13,16H,2-5,12H2,1H3,(H,26,31)(H2,28,29,30)/t13-,16+

Standard InChI Key:  OHXBXTJEURVRSV-AKAXFMLLSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   19.8066  -10.2851    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.6238  -10.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2152   -9.5773    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.8975   -8.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1817   -9.1243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4838   -8.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7680   -9.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7542   -9.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4521  -10.3390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1679   -9.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6133   -8.3331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0384  -10.3133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0246  -11.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2951  -12.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3088  -11.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6109  -11.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8951  -11.5022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8814  -12.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5793  -12.7385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3392   -9.8909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.4994   -7.8880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2148   -7.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9122   -7.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6254   -7.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6453   -6.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9457   -6.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2263   -6.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3622   -6.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0603   -6.7400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3809   -5.4983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0416   -7.5570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  3  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 16  2  1  0
 13 15  1  0
 12 13  1  0
  8 12  1  0
  2 20  1  0
  6 21  1  0
 22 21  1  1
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  1
 28 29  1  0
 28 30  2  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876360

    ---

Associated Targets(Human)

PRKCQ Tchem Protein kinase C theta (3319 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRKCD Tclin Protein kinase C delta (2953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.45Molecular Weight (Monoisotopic): 432.1885AlogP: 3.70#Rotatable Bonds: 6
Polar Surface Area: 102.73Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.55CX LogP: 1.98CX LogD: 1.92
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.57

References

1. Papa P, Whitefield B, Mortensen DS, Cashion D, Huang D, Torres E, Parnes J, Sapienza J, Hansen J, Correa M, Delgado M, Harris R, Hegde S, Norris S, Bahmanyar S, Plantevin-Krenitsky V, Liu Z, Leftheris K, Kulkarni A, Bennett B, Hur EM, Ringheim G, Khambatta G, Chan H, Muir J, Blease K, Burnett K, LeBrun L, Morrison L, Celeridad M, Khattri R, Cathers BE..  (2021)  Discovery of the Selective Protein Kinase C-θ Kinase Inhibitor, CC-90005.,  64  (16.0): [PMID:34355886] [10.1021/acs.jmedchem.1c00388]

Source