The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
cis-4-((5-Cyano-2-(((4-(trifluoromethylpyridin-3-yl)methyl)-amino)pyridin-4-yl)amino)-N-methylcyclohexane-1-carboxamide ID: ALA4876360
PubChem CID: 164628878
Max Phase: Preclinical
Molecular Formula: C21H23F3N6O
Molecular Weight: 432.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@H]1CC[C@@H](Nc2cc(NCc3cnccc3C(F)(F)F)ncc2C#N)CC1
Standard InChI: InChI=1S/C21H23F3N6O/c1-26-20(31)13-2-4-16(5-3-13)30-18-8-19(28-11-14(18)9-25)29-12-15-10-27-7-6-17(15)21(22,23)24/h6-8,10-11,13,16H,2-5,12H2,1H3,(H,26,31)(H2,28,29,30)/t13-,16+
Standard InChI Key: OHXBXTJEURVRSV-AKAXFMLLSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
19.8066 -10.2851 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.6238 -10.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2152 -9.5773 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.8975 -8.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1817 -9.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4838 -8.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7680 -9.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7542 -9.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4521 -10.3390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1679 -9.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6133 -8.3331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0384 -10.3133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0246 -11.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2951 -12.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3088 -11.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6109 -11.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8951 -11.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8814 -12.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5793 -12.7385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3392 -9.8909 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.4994 -7.8880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2148 -7.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9122 -7.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6254 -7.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6453 -6.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9457 -6.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2263 -6.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3622 -6.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0603 -6.7400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3809 -5.4983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0416 -7.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 11 3 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
16 2 1 0
13 15 1 0
12 13 1 0
8 12 1 0
2 20 1 0
6 21 1 0
22 21 1 1
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 1
28 29 1 0
28 30 2 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.45Molecular Weight (Monoisotopic): 432.1885AlogP: 3.70#Rotatable Bonds: 6Polar Surface Area: 102.73Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.55CX LogP: 1.98CX LogD: 1.92Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.57
References 1. Papa P, Whitefield B, Mortensen DS, Cashion D, Huang D, Torres E, Parnes J, Sapienza J, Hansen J, Correa M, Delgado M, Harris R, Hegde S, Norris S, Bahmanyar S, Plantevin-Krenitsky V, Liu Z, Leftheris K, Kulkarni A, Bennett B, Hur EM, Ringheim G, Khambatta G, Chan H, Muir J, Blease K, Burnett K, LeBrun L, Morrison L, Celeridad M, Khattri R, Cathers BE.. (2021) Discovery of the Selective Protein Kinase C-θ Kinase Inhibitor, CC-90005., 64 (16.0): [PMID:34355886 ] [10.1021/acs.jmedchem.1c00388 ]