1-(1-((4-(3,5-Dichlorophenoxy)pyridin-2-yl)methyl)piperidin-4-yl)-5-methylpyrimidine-2,4(1H,3H)-dione

ID: ALA4876370

PubChem CID: 164629115

Max Phase: Preclinical

Molecular Formula: C22H22Cl2N4O3

Molecular Weight: 461.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(C2CCN(Cc3cc(Oc4cc(Cl)cc(Cl)c4)ccn3)CC2)c(=O)[nH]c1=O

Standard InChI:  InChI=1S/C22H22Cl2N4O3/c1-14-12-28(22(30)26-21(14)29)18-3-6-27(7-4-18)13-17-11-19(2-5-25-17)31-20-9-15(23)8-16(24)10-20/h2,5,8-12,18H,3-4,6-7,13H2,1H3,(H,26,29,30)

Standard InChI Key:  OHRZNIZCKBWPCU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    1.1171  -30.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1159  -30.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8240  -31.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5336  -30.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5308  -30.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8222  -29.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2420  -31.3181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9490  -30.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6576  -31.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3642  -30.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3634  -30.0913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6500  -29.6840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9464  -30.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0724  -31.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7796  -30.9078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4871  -31.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1922  -30.9151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1955  -30.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4875  -29.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7762  -30.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9043  -29.6908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6101  -30.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3168  -29.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3232  -28.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6168  -28.4722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9039  -28.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0219  -30.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0336  -28.4808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1976  -28.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4079  -31.3192    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.8197  -28.8655    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 10 14  1  0
 14 15  1  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 23 27  1  0
 24 28  2  0
 26 29  2  0
  2 30  1  0
  6 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876370

    ---

Associated Targets(Human)

MRC5 (9203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

tmk Thymidylate kinase (360 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 461.35Molecular Weight (Monoisotopic): 460.1069AlogP: 4.18#Rotatable Bonds: 5
Polar Surface Area: 80.22Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.31CX Basic pKa: 7.22CX LogP: 3.09CX LogD: 2.87
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.62Np Likeness Score: -1.06

References

1. Song L, Merceron R, Hulpia F, Lucía A, Gracia B, Jian Y, Risseeuw MDP, Verstraelen T, Cos P, Aínsa JA, Boshoff HI, Munier-Lehmann H, Savvides SN, Van Calenbergh S..  (2021)  Structure-aided optimization of non-nucleoside M. tuberculosis thymidylate kinase inhibitors.,  225  [PMID:34450493] [10.1016/j.ejmech.2021.113784]

Source