Methyl 3-O-((5-carboxy)1H-benzo[d]imidazole-2-ylmethyl)-methoxy)-beta-D-galactopyranoside

ID: ALA4876385

PubChem CID: 164625971

Max Phase: Preclinical

Molecular Formula: C16H20N2O8

Molecular Weight: 368.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OCc2nc3ccc(C(=O)O)cc3[nH]2)[C@H]1O

Standard InChI:  InChI=1S/C16H20N2O8/c1-24-16-13(21)14(12(20)10(5-19)26-16)25-6-11-17-8-3-2-7(15(22)23)4-9(8)18-11/h2-4,10,12-14,16,19-21H,5-6H2,1H3,(H,17,18)(H,22,23)/t10-,12+,13-,14+,16-/m1/s1

Standard InChI Key:  HTARSASDRNDJSE-QPVMMRRFSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   41.8583   -4.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8583   -5.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5704   -5.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2825   -5.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2825   -4.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5704   -3.9004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.5704   -6.3757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.1444   -5.5557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9983   -3.9067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.1426   -3.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1402   -3.0816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9965   -5.5557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.7116   -4.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8559   -6.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8559   -7.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1927   -8.1008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5276   -8.1008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.2728   -8.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4507   -8.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0413   -9.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4527  -10.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2779  -10.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6836   -9.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6940  -11.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2849  -11.7326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.5190  -11.0120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  3  7  1  1
  2  8  1  1
  5  9  1  1
  1 10  1  1
 10 11  1  0
  4 12  1  6
  9 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  2  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 22 24  1  0
 24 25  2  0
 24 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876385

    ---

Associated Targets(Human)

LGALS8 Tchem Galectin-8 (303 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
LGALS3 Tchem Galectin-3 (545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.34Molecular Weight (Monoisotopic): 368.1220AlogP: -0.77#Rotatable Bonds: 6
Polar Surface Area: 154.36Molecular Species: ACIDHBA: 8HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 2.96CX Basic pKa: 4.94CX LogP: -2.14CX LogD: -4.18
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.44Np Likeness Score: 0.68

References

1. Hassan M, van Klaveren S, Håkansson M, Diehl C, Kovačič R, Baussière F, Sundin AP, Dernovšek J, Walse B, Zetterberg F, Leffler H, Anderluh M, Tomašič T, Jakopin Ž, Nilsson UJ..  (2021)  Benzimidazole-galactosides bind selectively to the Galectin-8 N-Terminal domain: Structure-based design and optimisation.,  223  [PMID:34225180] [10.1016/j.ejmech.2021.113664]

Source