The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-((2-chlorophenyl)amino)-6-fluoro-1H-indazol-1-yl)-N-(2-methoxyethyl)thiophene-2-carboxamide ID: ALA4876387
PubChem CID: 156155382
Max Phase: Preclinical
Molecular Formula: C21H18ClFN4O2S
Molecular Weight: 444.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCNC(=O)c1cc(-n2ncc3cc(Nc4ccccc4Cl)c(F)cc32)cs1
Standard InChI: InChI=1S/C21H18ClFN4O2S/c1-29-7-6-24-21(28)20-9-14(12-30-20)27-19-10-16(23)18(8-13(19)11-25-27)26-17-5-3-2-4-15(17)22/h2-5,8-12,26H,6-7H2,1H3,(H,24,28)
Standard InChI Key: XTFFMIPOKWLBRH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
4.2428 -6.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9546 -6.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5310 -6.2982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2428 -7.5322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7074 -6.6356 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2584 -6.0242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8456 -5.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0422 -5.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1779 -4.5616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3169 -3.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7661 -3.8540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0604 -3.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9764 -4.3976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6439 -4.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3957 -4.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4760 -3.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8076 -3.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2243 -3.3794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3038 -2.5620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0517 -2.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1315 -1.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4623 -0.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7154 -1.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6351 -2.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7192 -2.7056 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.0634 -5.0215 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5310 -5.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8191 -5.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1073 -5.4768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3996 -5.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 2 2 0
7 9 1 0
9 13 1 0
12 10 1 0
10 11 2 0
11 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
15 26 1 0
3 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.92Molecular Weight (Monoisotopic): 444.0823AlogP: 5.00#Rotatable Bonds: 7Polar Surface Area: 68.18Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.15CX LogP: 4.20CX LogD: 4.20Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -2.06
References 1. Feng Y, Park H, Ryu JC, Yoon SO.. (2021) N -Aromatic-Substituted Indazole Derivatives as Brain-Penetrant and Orally Bioavailable JNK3 Inhibitors., 12 (10.0): [PMID:34676036 ] [10.1021/acsmedchemlett.1c00334 ]