The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N-Dimethyl-3-({5-[1-(tetrahydro-2H-pyran-4-yl)[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]-pyridin-2-yl}oxy)propan-1-amine ID: ALA4876439
PubChem CID: 135218536
Max Phase: Preclinical
Molecular Formula: C24H28N6O2
Molecular Weight: 432.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCOc1ccc(-c2ccc3ncc4nnc(C5CCOCC5)n4c3c2)cn1
Standard InChI: InChI=1S/C24H28N6O2/c1-29(2)10-3-11-32-23-7-5-19(15-26-23)18-4-6-20-21(14-18)30-22(16-25-20)27-28-24(30)17-8-12-31-13-9-17/h4-7,14-17H,3,8-13H2,1-2H3
Standard InChI Key: OLUUKHAHFFWDFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
15.5046 -4.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5034 -5.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2156 -5.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2138 -4.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9266 -4.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9273 -5.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6400 -5.8408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3524 -5.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6344 -4.1962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3466 -4.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9463 -4.0429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6088 -3.3027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7965 -3.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2402 -2.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4920 -2.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9396 -1.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1364 -1.5753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8887 -2.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4399 -2.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7947 -4.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7959 -3.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0848 -2.9669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3762 -3.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3790 -4.2054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0865 -4.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6669 -2.9739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9608 -3.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2515 -2.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5454 -3.3905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8361 -2.9845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1300 -3.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8331 -2.1673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
13 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
1 20 1 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.53Molecular Weight (Monoisotopic): 432.2274AlogP: 3.56#Rotatable Bonds: 7Polar Surface Area: 77.67Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.26CX LogP: 1.48CX LogD: -0.38Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -1.47
References 1. Berger M, Wortmann L, Buchgraber P, Lücking U, Zitzmann-Kolbe S, Wengner AM, Bader B, Bömer U, Briem H, Eis K, Rehwinkel H, Bartels F, Moosmayer D, Eberspächer U, Lienau P, Hammer S, Schatz CA, Wang Q, Wang Q, Mumberg D, Nising CF, Siemeister G.. (2021) BAY-8400: A Novel Potent and Selective DNA-PK Inhibitor which Shows Synergistic Efficacy in Combination with Targeted Alpha Therapies., 64 (17.0): [PMID:34428039 ] [10.1021/acs.jmedchem.1c00762 ]