2-(4-(3-fluorophenoxy)phenyl)-7-(1-propioloylpiperidin-4-yl)-1H-imidazo[1,2-b]pyrazole-3-carboxamide

ID: ALA4876450

PubChem CID: 164627442

Max Phase: Preclinical

Molecular Formula: C26H22FN5O3

Molecular Weight: 471.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CC(=O)N1CCC(c2cnn3c(C(N)=O)c(-c4ccc(Oc5cccc(F)c5)cc4)[nH]c23)CC1

Standard InChI:  InChI=1S/C26H22FN5O3/c1-2-22(33)31-12-10-16(11-13-31)21-15-29-32-24(25(28)34)23(30-26(21)32)17-6-8-19(9-7-17)35-20-5-3-4-18(27)14-20/h1,3-9,14-16,30H,10-13H2,(H2,28,34)

Standard InChI Key:  DMOQEZVGMLQMQW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   21.9790  -26.2852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2349  -25.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5679  -25.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1527  -26.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8980  -25.5024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0746  -25.5039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8188  -26.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4866  -26.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4869  -27.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7698  -28.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7694  -28.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4845  -29.2457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2017  -28.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2038  -28.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5664  -24.1881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8494  -23.7742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2776  -23.7716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0176  -25.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6319  -25.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4177  -25.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5904  -24.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9711  -24.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1918  -24.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3765  -24.4826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9917  -25.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8167  -25.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4269  -26.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2140  -26.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3875  -25.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7718  -24.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4829  -30.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7702  -30.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1942  -30.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9060  -30.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1690  -25.0717    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  2  0
  3  5  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  2  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8  9  1  0
  3 15  1  0
 15 16  2  0
 15 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  2 18  1  0
 21 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 12 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  3  0
 29 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876450

    ---

Associated Targets(Human)

BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.49Molecular Weight (Monoisotopic): 471.1707AlogP: 3.70#Rotatable Bonds: 5
Polar Surface Area: 105.72Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.95CX Basic pKa: 0.16CX LogP: 2.96CX LogD: 2.96
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.11

References

1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q..  (2021)  Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase.,  225  [PMID:34391034] [10.1016/j.ejmech.2021.113724]

Source