The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl 4-((6-((1-(methanesulfonyl)piperidin-4-yl)amino)pyrimidin-4-yl)(trifluoromethyl)amino)piperidine-1-carboxylate ID: ALA4876465
PubChem CID: 164627706
Max Phase: Preclinical
Molecular Formula: C21H33F3N6O4S
Molecular Weight: 522.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCC(N(c2cc(NC3CCN(S(C)(=O)=O)CC3)ncn2)C(F)(F)F)CC1
Standard InChI: InChI=1S/C21H33F3N6O4S/c1-20(2,3)34-19(31)28-9-7-16(8-10-28)30(21(22,23)24)18-13-17(25-14-26-18)27-15-5-11-29(12-6-15)35(4,32)33/h13-16H,5-12H2,1-4H3,(H,25,26,27)
Standard InChI Key: CFZZZDOEMJABTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
13.8044 -17.0795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3919 -16.4962 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.5930 -16.2790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7587 -21.0338 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.0462 -20.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0452 -21.4446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.8838 -18.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8880 -19.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6003 -19.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3999 -18.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9469 -19.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7536 -19.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0110 -18.4392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4555 -17.8234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6509 -17.9958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3040 -19.8386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1114 -19.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6602 -20.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4645 -20.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7258 -19.3399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1762 -18.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3655 -18.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5338 -19.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0818 -19.7904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7939 -18.3907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4380 -20.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2394 -20.7918 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.5929 -18.9504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0411 -18.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3009 -17.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7531 -16.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9447 -17.1118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6873 -17.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2380 -18.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6537 -15.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
8 7 1 0
9 8 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
12 16 1 0
16 17 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 8 1 0
8 26 1 0
16 5 1 0
5 27 1 0
10 28 1 0
28 29 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
32 2 1 0
2 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.59Molecular Weight (Monoisotopic): 522.2236AlogP: 3.04#Rotatable Bonds: 5Polar Surface Area: 107.97Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.07CX LogP: 2.08CX LogD: 2.06Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.59Np Likeness Score: -1.54
References 1. Kubo O, Takami K, Kamaura M, Watanabe K, Miyashita H, Abe S, Matsuda K, Tsujihata Y, Odani T, Iwasaki S, Kitazaki T, Murata T, Sato K.. (2021) Discovery of a novel series of GPR119 agonists: Design, synthesis, and biological evaluation of N-(Piperidin-4-yl)-N-(trifluoromethyl)pyrimidin-4-amine derivatives., 41 [PMID:34010766 ] [10.1016/j.bmc.2021.116208 ]