N-((1-(3-chlorophenyl)-3-(trifluoromethyl)-1H-pyrazol-5-yl)methyl)-2-(2,3-dichlorophenyl)propanamide

ID: ALA4876521

PubChem CID: 164628678

Max Phase: Preclinical

Molecular Formula: C20H15Cl3F3N3O

Molecular Weight: 476.71

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C(=O)NCc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1)c1cccc(Cl)c1Cl

Standard InChI:  InChI=1S/C20H15Cl3F3N3O/c1-11(15-6-3-7-16(22)18(15)23)19(30)27-10-14-9-17(20(24,25)26)28-29(14)13-5-2-4-12(21)8-13/h2-9,11H,10H2,1H3,(H,27,30)

Standard InChI Key:  TYIJVRPVKSCKTH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   19.7072   -5.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5299   -6.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1403   -6.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9284   -6.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1024   -5.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4906   -5.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5395   -7.2986    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.6639   -4.5735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4128   -4.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3283   -3.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5216   -3.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1077   -3.9571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1877   -2.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6741   -1.8227    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.3674   -2.4012    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.9308   -1.6977    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.1273   -4.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8417   -4.2370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5563   -4.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2706   -4.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5566   -5.4742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9852   -4.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9824   -5.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6963   -5.8841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4115   -5.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4086   -4.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6941   -4.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6900   -3.4086    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.1214   -4.2268    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.2703   -3.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
  9 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
 26 29  1  0
 20 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876521

    ---

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.71Molecular Weight (Monoisotopic): 475.0233AlogP: 6.27#Rotatable Bonds: 5
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.58CX Basic pKa: CX LogP: 6.38CX LogD: 6.38
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.66

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source