The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-(4-((6-isobutoxy-3-oxobenzofuran-2(3H)-ylidene)methyl)-2,6-dimethylphenoxy)acetic acid ID: ALA4876536
PubChem CID: 147391493
Max Phase: Preclinical
Molecular Formula: C23H24O6
Molecular Weight: 396.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(/C=C2\Oc3cc(OCC(C)C)ccc3C2=O)cc(C)c1OCC(=O)O
Standard InChI: InChI=1S/C23H24O6/c1-13(2)11-27-17-5-6-18-19(10-17)29-20(22(18)26)9-16-7-14(3)23(15(4)8-16)28-12-21(24)25/h5-10,13H,11-12H2,1-4H3,(H,24,25)/b20-9-
Standard InChI Key: DMYMKTPYFGFERF-UKWGHVSLSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
35.2465 -2.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3225 -4.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3214 -5.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0294 -6.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0277 -4.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6147 -4.5112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7363 -4.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7411 -5.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5211 -5.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9985 -5.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5133 -4.6586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8156 -5.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2201 -4.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7781 -6.7588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0371 -4.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4415 -3.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0287 -3.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2073 -3.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8066 -3.9027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7920 -2.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2587 -3.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4321 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6528 -1.7582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4700 -1.7523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2391 -1.0535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6145 -3.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9067 -3.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9065 -2.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1991 -3.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 8 2 0
7 5 2 0
5 2 1 0
2 6 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
10 12 2 0
12 13 1 0
9 14 2 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 13 1 0
18 20 1 0
16 21 1 0
17 22 1 0
22 1 1 0
1 23 1 0
23 24 1 0
23 25 2 0
6 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.44Molecular Weight (Monoisotopic): 396.1573AlogP: 4.42#Rotatable Bonds: 7Polar Surface Area: 82.06Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.71CX Basic pKa: ┄CX LogP: 4.64CX LogD: 1.34Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -0.36
References 1. Li Z, Ren Q, Zhou Z, Cai Z, Wang B, Han J, Zhang L.. (2021) Discovery of the first-in-class dual PPARδ/γ partial agonist for the treatment of metabolic syndrome., 225 [PMID:34455359 ] [10.1016/j.ejmech.2021.113807 ]