The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-cyclohexyl-2-(3,4-dimethoxyphenethyl)-7-(3,5-dimethylisoxazol-4-yl)imidazo[1,2-a]pyridin-3-amine ID: ALA4876541
PubChem CID: 164628694
Max Phase: Preclinical
Molecular Formula: C28H34N4O3
Molecular Weight: 474.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCc2nc3cc(-c4c(C)noc4C)ccn3c2NC2CCCCC2)cc1OC
Standard InChI: InChI=1S/C28H34N4O3/c1-18-27(19(2)35-31-18)21-14-15-32-26(17-21)30-23(28(32)29-22-8-6-5-7-9-22)12-10-20-11-13-24(33-3)25(16-20)34-4/h11,13-17,22,29H,5-10,12H2,1-4H3
Standard InChI Key: LLQORKQXLLCXHC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
38.6554 -3.8955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2067 -4.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2059 -5.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9141 -6.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9117 -4.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6205 -4.9415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6255 -5.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4057 -6.0083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8828 -5.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3975 -4.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5023 -6.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7559 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2088 -6.4485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6171 -7.1565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4165 -6.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5863 -5.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0235 -7.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7000 -5.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1130 -6.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9301 -6.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1099 -3.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3704 -2.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8288 -1.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0279 -2.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7715 -2.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3161 -3.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3389 -6.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1553 -6.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5603 -6.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1429 -5.3193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3279 -5.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3775 -6.0206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.7914 -6.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5446 -4.6076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3618 -4.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 7 1 0
6 5 1 0
5 2 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 6 1 0
10 1 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 11 2 0
3 11 1 0
12 16 1 0
15 17 1 0
9 18 1 0
18 19 1 0
19 20 1 0
1 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
20 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 20 1 0
29 32 1 0
32 33 1 0
30 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.61Molecular Weight (Monoisotopic): 474.2631AlogP: 6.15#Rotatable Bonds: 8Polar Surface Area: 73.82Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.17CX LogP: 4.56CX LogD: 4.36Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.86
References 1. Muthengi A, Wimalasena VK, Yosief HO, Bikowitz MJ, Sigua LH, Wang T, Li D, Gaieb Z, Dhawan G, Liu S, Erickson J, Amaro RE, Schönbrunn E, Qi J, Zhang W.. (2021) Development of Dimethylisoxazole-Attached Imidazo[1,2-a ]pyridines as Potent and Selective CBP/P300 Inhibitors., 64 (9.0): [PMID:33872011 ] [10.1021/acs.jmedchem.0c02232 ]