The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(4-chlorophenyl)thiazol-2-yl)-1-(2-methoxyphenyl)-7,7-dimethyl-7,8-dihydroquinoline-2,5(1H,6H)-dione ID: ALA4876576
PubChem CID: 121450881
Max Phase: Preclinical
Molecular Formula: C27H23ClN2O3S
Molecular Weight: 491.01
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1-n1c2c(cc(-c3nc(-c4ccc(Cl)cc4)cs3)c1=O)C(=O)CC(C)(C)C2
Standard InChI: InChI=1S/C27H23ClN2O3S/c1-27(2)13-22-18(23(31)14-27)12-19(26(32)30(22)21-6-4-5-7-24(21)33-3)25-29-20(15-34-25)16-8-10-17(28)11-9-16/h4-12,15H,13-14H2,1-3H3
Standard InChI Key: MFUYVQPLTBUMPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
13.8791 -20.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2958 -19.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4705 -19.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2958 -18.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0078 -19.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0078 -18.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7199 -18.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7163 -19.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4251 -19.7257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1419 -19.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1454 -18.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4321 -18.0757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0078 -17.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8541 -19.7351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4206 -20.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7021 -20.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6971 -21.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4098 -22.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1290 -21.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1305 -20.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8589 -18.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6108 -18.4211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1661 -17.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7573 -17.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9495 -17.2616 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.9854 -17.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3163 -18.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1354 -18.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6247 -18.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2890 -17.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4707 -17.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4449 -18.1721 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.8461 -20.5526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5594 -20.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 6 1 0
2 5 1 0
5 8 1 0
7 6 1 0
7 8 2 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
6 13 2 0
10 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
9 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
11 21 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
23 26 1 0
29 32 1 0
20 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.01Molecular Weight (Monoisotopic): 490.1118AlogP: 6.45#Rotatable Bonds: 4Polar Surface Area: 61.19Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.95CX LogD: 5.95Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -1.07
References 1. Rohde JM, Karavadhi S, Pragani R, Liu L, Fang Y, Zhang W, McIver A, Zheng H, Liu Q, Davis MI, Urban DJ, Lee TD, Cheff DM, Hollingshead M, Henderson MJ, Martinez NJ, Brimacombe KR, Yasgar A, Zhao W, Klumpp-Thomas C, Michael S, Covey J, Moore WJ, Stott GM, Li Z, Simeonov A, Jadhav A, Frye S, Hall MD, Shen M, Wang X, Patnaik S, Boxer MB.. (2021) Discovery and Optimization of 2H -1λ2 -Pyridin-2-one Inhibitors of Mutant Isocitrate Dehydrogenase 1 for the Treatment of Cancer., 64 (8.0): [PMID:33822623 ] [10.1021/acs.jmedchem.1c00019 ]