The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methoxy-N-(2-((2-(((S)-1-(3-methoxyphenyl)ethyl)amino)-2-oxoethyl)thio)benzo[d]thiazol-6-yl)-3-methyl-4-(pentan-2-yloxy)benzamide ID: ALA4876597
PubChem CID: 141483841
Max Phase: Preclinical
Molecular Formula: C32H37N3O5S2
Molecular Weight: 607.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4cccc(OC)c4)sc3c2)c(OC)c1C
Standard InChI: InChI=1S/C32H37N3O5S2/c1-7-9-19(2)40-27-15-13-25(30(39-6)20(27)3)31(37)34-23-12-14-26-28(17-23)42-32(35-26)41-18-29(36)33-21(4)22-10-8-11-24(16-22)38-5/h8,10-17,19,21H,7,9,18H2,1-6H3,(H,33,36)(H,34,37)/t19?,21-/m0/s1
Standard InChI Key: GEAAYPAXOKOWCS-QWAKEFERSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
23.4310 -19.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4299 -19.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1424 -20.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8607 -19.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8578 -19.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1406 -18.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1381 -17.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8532 -17.3705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4248 -17.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5707 -17.7837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2859 -17.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0034 -17.7795 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.7184 -17.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4715 -17.6950 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.7985 -16.5365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6065 -16.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0156 -17.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8383 -17.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2531 -16.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8349 -15.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0134 -15.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0796 -16.3635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4917 -17.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3181 -17.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7306 -17.7972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5564 -17.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9674 -17.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5510 -16.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7267 -16.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7939 -17.0771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5732 -18.6102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0813 -17.7962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2069 -17.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0292 -17.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7976 -18.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4422 -18.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2646 -18.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9597 -15.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3125 -15.6548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7206 -14.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7164 -20.2638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0056 -19.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 1 6
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 17 1 0
16 15 1 0
15 13 2 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
10 31 2 0
23 32 2 0
30 33 1 0
33 34 1 0
33 35 1 0
34 36 1 0
36 37 1 0
28 38 1 0
29 39 1 0
39 40 1 0
2 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.80Molecular Weight (Monoisotopic): 607.2175AlogP: 7.41#Rotatable Bonds: 13Polar Surface Area: 98.78Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.48CX Basic pKa: 1.07CX LogP: 7.02CX LogD: 7.02Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -1.67
References 1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y.. (2021) Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors., 216 [PMID:33689932 ] [10.1016/j.ejmech.2021.113333 ]