The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclohexyl-7-(3,5-dimethylisoxazol-4-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-3-amine ID: ALA4876603
PubChem CID: 137410586
Max Phase: Preclinical
Molecular Formula: C25H28N4O2
Molecular Weight: 416.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nc3cc(-c4c(C)noc4C)ccn3c2NC2CCCCC2)cc1
Standard InChI: InChI=1S/C25H28N4O2/c1-16-23(17(2)31-28-16)19-13-14-29-22(15-19)27-24(18-9-11-21(30-3)12-10-18)25(29)26-20-7-5-4-6-8-20/h9-15,20,26H,4-8H2,1-3H3
Standard InChI Key: LBBNDHGHZZZYIT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
30.6651 -3.0866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2164 -4.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2156 -4.9562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9237 -5.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9214 -3.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6302 -4.1326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6352 -4.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4153 -5.1994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8925 -4.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4072 -3.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7077 -4.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1201 -5.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9365 -5.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3415 -4.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9241 -3.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1090 -3.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1587 -4.5136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5726 -5.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5120 -5.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7656 -5.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2185 -5.6396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6268 -6.3475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4261 -6.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5960 -4.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0332 -6.7249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1196 -2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3787 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8370 -1.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0361 -1.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7798 -2.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3243 -2.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 7 1 0
6 5 1 0
5 2 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 6 1 0
10 1 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 11 1 0
14 17 1 0
17 18 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
3 19 1 0
20 24 1 0
23 25 1 0
1 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.53Molecular Weight (Monoisotopic): 416.2212AlogP: 6.03#Rotatable Bonds: 5Polar Surface Area: 64.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.48CX LogP: 4.34CX LogD: 4.29Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.27
References 1. Muthengi A, Wimalasena VK, Yosief HO, Bikowitz MJ, Sigua LH, Wang T, Li D, Gaieb Z, Dhawan G, Liu S, Erickson J, Amaro RE, Schönbrunn E, Qi J, Zhang W.. (2021) Development of Dimethylisoxazole-Attached Imidazo[1,2-a ]pyridines as Potent and Selective CBP/P300 Inhibitors., 64 (9.0): [PMID:33872011 ] [10.1021/acs.jmedchem.0c02232 ]