4-(7-chloro-4-(4,4-difluoropiperidin-1-yl)quinazolin-2-yl)-N-hydroxybenzamide

ID: ALA4876619

PubChem CID: 164626551

Max Phase: Preclinical

Molecular Formula: C20H17ClF2N4O2

Molecular Weight: 418.83

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NO)c1ccc(-c2nc(N3CCC(F)(F)CC3)c3ccc(Cl)cc3n2)cc1

Standard InChI:  InChI=1S/C20H17ClF2N4O2/c21-14-5-6-15-16(11-14)24-17(12-1-3-13(4-2-12)19(28)26-29)25-18(15)27-9-7-20(22,23)8-10-27/h1-6,11,29H,7-10H2,(H,26,28)

Standard InChI Key:  VDJGBVUDQMXKEM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   18.1062  -10.1076    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.5189  -10.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9273  -10.1051    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.4084  -13.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4073  -14.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1153  -14.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1136  -13.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8222  -13.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8229  -14.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5315  -14.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2397  -14.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2350  -13.6713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5259  -13.2679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9490  -14.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9473  -15.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6558  -16.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3629  -15.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3570  -14.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6480  -14.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0727  -16.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0770  -16.9299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7783  -15.7004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4881  -16.1053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5216  -12.4507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2315  -12.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2291  -11.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8137  -11.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8144  -12.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6993  -14.9093    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 13 24  1  0
 24 25  1  0
 24 28  1  0
 25 26  1  0
 26  2  1  0
  2 27  1  0
 27 28  1  0
  5 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876619

    ---

Associated Targets(Human)

MTOR Tclin Serine/threonine-protein kinase mTOR (13850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC6 Tclin Histone deacetylase 6 (20808 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.83Molecular Weight (Monoisotopic): 418.1008AlogP: 4.30#Rotatable Bonds: 3
Polar Surface Area: 78.35Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.98CX Basic pKa: 4.04CX LogP: 4.70CX LogD: 4.69
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -1.39

References

1. Yao D, Jiang J, Zhang H, Huang Y, Huang J, Wang J..  (2021)  Design, synthesis and biological evaluation of dual mTOR/HDAC6 inhibitors in MDA-MB-231 cells.,  47  [PMID:34139324] [10.1016/j.bmcl.2021.128204]

Source