N-(1-Cyclopropyl-2-(methylamino)-2-oxoethyl)-N-(2,2-diphenylethyl)-1,5-dimethyl-6-oxo-1,6-dihydropyridine-3-carboxamide

ID: ALA4876640

PubChem CID: 164627040

Max Phase: Preclinical

Molecular Formula: C28H31N3O3

Molecular Weight: 457.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)C(C1CC1)N(CC(c1ccccc1)c1ccccc1)C(=O)c1cc(C)c(=O)n(C)c1

Standard InChI:  InChI=1S/C28H31N3O3/c1-19-16-23(17-30(3)27(19)33)28(34)31(25(22-14-15-22)26(32)29-2)18-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,16-17,22,24-25H,14-15,18H2,1-3H3,(H,29,32)

Standard InChI Key:  MLXZSIGTJPQSFT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   21.8811  -17.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8800  -17.9310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5880  -18.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2977  -17.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2949  -17.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5863  -16.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1733  -16.7030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5838  -15.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0061  -18.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0073  -19.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7131  -17.9283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4209  -18.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7118  -17.1111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4189  -16.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4176  -15.8842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1273  -17.1089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8343  -16.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6647  -19.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4626  -19.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1128  -19.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3153  -19.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7637  -20.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0095  -20.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8120  -21.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3602  -20.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7054  -20.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5024  -20.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0553  -19.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8055  -18.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0090  -18.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1720  -18.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0035  -16.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5951  -16.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1876  -16.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  2  0
  6  8  1  0
  4  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 12 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 19  1  0
  2 31  1  0
 13 32  1  0
 33 32  1  0
 34 33  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876640

    ---

Associated Targets(Human)

BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.57Molecular Weight (Monoisotopic): 457.2365AlogP: 3.49#Rotatable Bonds: 8
Polar Surface Area: 71.41Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.28CX LogP: 3.11CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -0.77

References

1. Rianjongdee F, Atkinson SJ, Chung CW, Grandi P, Gray JRJ, Kaushansky LJ, Medeiros P, Messenger C, Phillipou A, Preston A, Prinjha RK, Rioja I, Satz AL, Taylor S, Wall ID, Watson RJ, Yao G, Demont EH..  (2021)  Discovery of a Highly Selective BET BD2 Inhibitor from a DNA-Encoded Library Technology Screening Hit.,  64  (15.0): [PMID:34251219] [10.1021/acs.jmedchem.1c00412]

Source