N-((1-(3-chlorophenyl)-3-(trifluoromethyl)-1H-pyrazol-5-yl)methyl)-2-(3,4-difluorophenyl)acetamide

ID: ALA4876726

PubChem CID: 164628530

Max Phase: Preclinical

Molecular Formula: C19H13ClF5N3O

Molecular Weight: 429.78

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(F)c(F)c1)NCc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1

Standard InChI:  InChI=1S/C19H13ClF5N3O/c20-12-2-1-3-13(8-12)28-14(9-17(27-28)19(23,24)25)10-26-18(29)7-11-4-5-15(21)16(22)6-11/h1-6,8-9H,7,10H2,(H,26,29)

Standard InChI Key:  DPEBFVIAPYKMIC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    2.4865  -22.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3093  -23.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9197  -24.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7077  -24.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8819  -23.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2700  -22.6678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3189  -24.5862    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.4433  -21.8612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1921  -21.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1077  -20.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3011  -20.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8871  -21.2448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9671  -19.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4534  -19.1104    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.1468  -19.6887    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7102  -18.9852    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.9068  -21.9373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6211  -21.5245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3357  -21.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0501  -21.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3360  -22.7617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7646  -21.9362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7619  -22.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4757  -23.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1910  -22.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1880  -21.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4736  -21.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9009  -21.5144    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.9062  -23.1702    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
  9 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 26 28  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876726

    ---

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.78Molecular Weight (Monoisotopic): 429.0667AlogP: 4.68#Rotatable Bonds: 5
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.59CX Basic pKa: CX LogP: 4.91CX LogD: 4.91
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.60Np Likeness Score: -2.08

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source