3-(4-(4-chlorophenyl)thiazol-2-yl)-1-(2-hydroxyphenyl)-7,7-dimethyl-7,8-dihydroquinoline-2,5(1H,6H)-dione

ID: ALA4876738

PubChem CID: 137548494

Max Phase: Preclinical

Molecular Formula: C26H21ClN2O3S

Molecular Weight: 476.99

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)CC(=O)c2cc(-c3nc(-c4ccc(Cl)cc4)cs3)c(=O)n(-c3ccccc3O)c2C1

Standard InChI:  InChI=1S/C26H21ClN2O3S/c1-26(2)12-21-17(23(31)13-26)11-18(25(32)29(21)20-5-3-4-6-22(20)30)24-28-19(14-33-24)15-7-9-16(27)10-8-15/h3-11,14,30H,12-13H2,1-2H3

Standard InChI Key:  NWJPKGLFUBNBGS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    2.9920   -4.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4087   -3.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5832   -3.6916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4087   -2.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1208   -4.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1208   -2.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8328   -2.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8293   -3.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5381   -4.1095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2550   -3.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2585   -2.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5452   -2.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1208   -1.6293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9672   -4.1188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5336   -4.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8151   -5.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8102   -6.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5229   -6.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2421   -6.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2436   -5.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9721   -2.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7240   -2.8047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2793   -2.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8705   -1.4777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0627   -1.6451    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.0987   -2.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4296   -3.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2489   -3.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7383   -2.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4025   -1.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5842   -1.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5584   -2.5556    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.9593   -4.9364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  4  6  1  0
  2  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
  6 13  2  0
 10 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  9 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 11 21  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 26  1  0
 29 32  1  0
 20 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876738

    ---

Associated Targets(Human)

IDH1 Tclin Isocitrate dehydrogenase [NADP] cytoplasmic (40980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.99Molecular Weight (Monoisotopic): 476.0961AlogP: 6.14#Rotatable Bonds: 3
Polar Surface Area: 72.19Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.54CX Basic pKa: CX LogP: 5.81CX LogD: 5.77
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -0.89

References

1. Rohde JM, Karavadhi S, Pragani R, Liu L, Fang Y, Zhang W, McIver A, Zheng H, Liu Q, Davis MI, Urban DJ, Lee TD, Cheff DM, Hollingshead M, Henderson MJ, Martinez NJ, Brimacombe KR, Yasgar A, Zhao W, Klumpp-Thomas C, Michael S, Covey J, Moore WJ, Stott GM, Li Z, Simeonov A, Jadhav A, Frye S, Hall MD, Shen M, Wang X, Patnaik S, Boxer MB..  (2021)  Discovery and Optimization of 2H-1λ2-Pyridin-2-one Inhibitors of Mutant Isocitrate Dehydrogenase 1 for the Treatment of Cancer.,  64  (8.0): [PMID:33822623] [10.1021/acs.jmedchem.1c00019]

Source