N-(4-bromophenyl)-2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)acetamide

ID: ALA4876741

PubChem CID: 164628699

Max Phase: Preclinical

Molecular Formula: C22H15BrI2N4O4S2

Molecular Weight: 797.23

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccc(Br)cc3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C22H15BrI2N4O4S2/c23-12-1-3-14(4-2-12)27-19(30)11-34-22-28-20-17(9-13(24)10-18(20)25)21(31)29(22)15-5-7-16(8-6-15)35(26,32)33/h1-10H,11H2,(H,27,30)(H2,26,32,33)

Standard InChI Key:  NVYVLVHUULPRPV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   43.5588  -16.8969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9715  -17.6068    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   44.3799  -16.8944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2993  -19.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2981  -20.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0062  -20.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0044  -18.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7130  -19.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7118  -20.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4219  -20.4658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1377  -20.0565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1389  -19.2313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4243  -18.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5915  -18.8244    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   39.0059  -21.2785    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   40.4243  -17.9982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.8459  -18.8270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5529  -19.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2611  -18.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2636  -18.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5519  -17.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8466  -18.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8443  -20.4671    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   44.6790  -18.0164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5532  -20.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2597  -20.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9686  -20.0645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.2574  -21.2883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.6751  -20.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6681  -21.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3738  -21.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0836  -21.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0833  -20.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3770  -20.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.7907  -21.7028    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876741

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 797.23Molecular Weight (Monoisotopic): 795.7808AlogP: 4.74#Rotatable Bonds: 6
Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.12CX Basic pKa: CX LogP: 5.86CX LogD: 5.86
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -2.17

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source