4-((1-(2,5-Dimethoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl)sulfonyl)benzoic Acid

ID: ALA4876742

PubChem CID: 164628700

Max Phase: Preclinical

Molecular Formula: C18H17N3O6S

Molecular Weight: 403.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(OC)c(-n2nnc(S(=O)(=O)c3ccc(C(=O)O)cc3)c2C)c1

Standard InChI:  InChI=1S/C18H17N3O6S/c1-11-17(28(24,25)14-7-4-12(5-8-14)18(22)23)19-20-21(11)15-10-13(26-2)6-9-16(15)27-3/h4-10H,1-3H3,(H,22,23)

Standard InChI Key:  SAPSNJYHXYUMBH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    8.0151  -21.3336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3052  -20.9209    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3042  -21.7405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0527  -19.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0516  -20.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7638  -20.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4775  -20.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4747  -19.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7620  -19.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1860  -20.6514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2727  -21.4681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0765  -21.6368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4840  -20.9243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9320  -20.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7595  -18.1884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4701  -17.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7636  -21.4766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0516  -21.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1048  -19.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7150  -20.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5369  -20.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9425  -19.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5310  -18.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7055  -18.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2994  -19.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9367  -18.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7538  -18.0756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5251  -17.3730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  7 10  1  0
  9 15  1  0
 15 16  1  0
  6 17  1  0
 17 18  1  0
 14 19  1  0
 13  2  1  0
  2 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  2  0
 26 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876742

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.42Molecular Weight (Monoisotopic): 403.0838AlogP: 2.12#Rotatable Bonds: 6
Polar Surface Area: 120.61Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.50CX Basic pKa: CX LogP: 2.77CX LogD: -0.61
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -1.40

References

1. Li Y, Lin W, Wright WC, Chai SC, Wu J, Chen T..  (2021)  Building a Chemical Toolbox for Human Pregnane X Receptor Research: Discovery of Agonists, Inverse Agonists, and Antagonists Among Analogs Based on the Unique Chemical Scaffold of SPA70.,  64  (3.0): [PMID:33497575] [10.1021/acs.jmedchem.0c02201]

Source