The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(2-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)ethyl)phenyl)-4-methyl-3-((4-(pyridin-2-yl)pyrimidin-2-yl)-amino)benzamide ID: ALA4876765
PubChem CID: 164625981
Max Phase: Preclinical
Molecular Formula: C36H36N6O3
Molecular Weight: 600.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(CCc1ccc(NC(=O)c3ccc(C)c(Nc4nccc(-c5ccccn5)n4)c3)cc1)CC2
Standard InChI: InChI=1S/C36H36N6O3/c1-24-7-10-27(20-32(24)41-36-38-17-13-31(40-36)30-6-4-5-16-37-30)35(43)39-29-11-8-25(9-12-29)14-18-42-19-15-26-21-33(44-2)34(45-3)22-28(26)23-42/h4-13,16-17,20-22H,14-15,18-19,23H2,1-3H3,(H,39,43)(H,38,40,41)
Standard InChI Key: DZYZUWFHTUOLPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
20.8452 -11.4984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8441 -12.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5562 -12.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2700 -12.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2672 -11.4948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5545 -11.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5520 -10.2641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2626 -9.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9694 -10.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6796 -9.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6776 -9.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9595 -8.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2565 -9.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5417 -8.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3924 -10.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3945 -11.0804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1032 -9.8487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8161 -10.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8151 -11.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5271 -11.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2389 -11.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2342 -10.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5216 -9.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9523 -11.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6584 -11.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3718 -11.4753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3703 -12.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0796 -12.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0773 -11.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7911 -11.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7907 -12.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5015 -12.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2132 -12.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2097 -11.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4983 -11.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9196 -11.0507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9260 -12.6984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6328 -12.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6292 -11.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9749 -12.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9738 -13.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6808 -13.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3893 -13.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3865 -12.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6789 -12.3200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
10 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 29 1 0
27 28 1 0
28 31 1 0
30 29 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
34 36 1 0
33 37 1 0
37 38 1 0
36 39 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
4 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 600.72Molecular Weight (Monoisotopic): 600.2849AlogP: 6.46#Rotatable Bonds: 10Polar Surface Area: 101.50Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.26CX Basic pKa: 8.36CX LogP: 6.65CX LogD: 5.65Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.19Np Likeness Score: -1.30
References 1. Qiu Q, Zou F, Li H, Shi W, Zhou D, Zhang P, Li T, Yin Z, Cai Z, Jiang Y, Huang W, Qian H.. (2021) Structure-Based Discovery of Pyrimidine Aminobenzene Derivatives as Potent Oral Reversal Agents against P-gp- and BCRP-Mediated Multidrug Resistance., 64 (9.0): [PMID:33938746 ] [10.1021/acs.jmedchem.1c00246 ]