N'1-(naphthalen-1-ylmethylene)-N'5-(naphthalen-2-ylmethylene)glutarohydrazide

ID: ALA4876787

PubChem CID: 164626203

Max Phase: Preclinical

Molecular Formula: C27H24N4O2

Molecular Weight: 436.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCC(=O)N/N=C/c1cccc2ccccc12)N/N=C/c1ccc2ccccc2c1

Standard InChI:  InChI=1S/C27H24N4O2/c32-26(30-28-18-20-15-16-21-7-1-2-9-23(21)17-20)13-6-14-27(33)31-29-19-24-11-5-10-22-8-3-4-12-25(22)24/h1-5,7-12,15-19H,6,13-14H2,(H,30,32)(H,31,33)/b28-18+,29-19+

Standard InChI Key:  HZENJLBMQOKQOU-UOSOPFLXSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   12.6196   -1.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6185   -2.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3265   -2.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3248   -0.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0334   -1.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0341   -1.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7427   -2.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4509   -1.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4462   -1.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7371   -0.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7444   -3.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4529   -3.6313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4546   -4.4485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1632   -4.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1649   -5.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8700   -4.4455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8734   -6.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8751   -6.8971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5837   -7.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5854   -8.1214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2905   -6.8942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2939   -8.5285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2956   -9.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0042   -9.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0007  -10.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7084  -10.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7036   -9.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4119   -9.7464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4148  -10.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1231  -10.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8290  -10.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8221   -9.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1133   -9.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  7 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 29  2  0
 28 27  2  0
 27 24  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876787

    ---

Associated Targets(Human)

PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.51Molecular Weight (Monoisotopic): 436.1899AlogP: 4.76#Rotatable Bonds: 8
Polar Surface Area: 82.92Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.55CX Basic pKa: 2.34CX LogP: 4.69CX LogD: 4.69
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.97

References

1. Almahmoud S, Elix CC, Jones JO, Hopkins CR, Vennerstrom JL, Zhong HA..  (2021)  Virtual screening and biological evaluation of PPARγ antagonists as potential anti-prostate cancer agents.,  46  [PMID:34433102] [10.1016/j.bmc.2021.116368]

Source