The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'1-(naphthalen-1-ylmethylene)-N'5-(naphthalen-2-ylmethylene)glutarohydrazide ID: ALA4876787
PubChem CID: 164626203
Max Phase: Preclinical
Molecular Formula: C27H24N4O2
Molecular Weight: 436.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCC(=O)N/N=C/c1cccc2ccccc12)N/N=C/c1ccc2ccccc2c1
Standard InChI: InChI=1S/C27H24N4O2/c32-26(30-28-18-20-15-16-21-7-1-2-9-23(21)17-20)13-6-14-27(33)31-29-19-24-11-5-10-22-8-3-4-12-25(22)24/h1-5,7-12,15-19H,6,13-14H2,(H,30,32)(H,31,33)/b28-18+,29-19+
Standard InChI Key: HZENJLBMQOKQOU-UOSOPFLXSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
12.6196 -1.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6185 -2.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3265 -2.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3248 -0.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0334 -1.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0341 -1.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7427 -2.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4509 -1.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4462 -1.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7371 -0.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7444 -3.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4529 -3.6313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4546 -4.4485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1632 -4.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1649 -5.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8700 -4.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8734 -6.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8751 -6.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5837 -7.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5854 -8.1214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2905 -6.8942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2939 -8.5285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2956 -9.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0042 -9.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0007 -10.5709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7084 -10.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7036 -9.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4119 -9.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4148 -10.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1231 -10.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8290 -10.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8221 -9.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1133 -9.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
7 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 29 2 0
28 27 2 0
27 24 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.51Molecular Weight (Monoisotopic): 436.1899AlogP: 4.76#Rotatable Bonds: 8Polar Surface Area: 82.92Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.55CX Basic pKa: 2.34CX LogP: 4.69CX LogD: 4.69Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.97
References 1. Almahmoud S, Elix CC, Jones JO, Hopkins CR, Vennerstrom JL, Zhong HA.. (2021) Virtual screening and biological evaluation of PPARγ antagonists as potential anti-prostate cancer agents., 46 [PMID:34433102 ] [10.1016/j.bmc.2021.116368 ]