8-(3-Chloro-5-(1-methyl-1H-pyrazol-4-yl)pyridin-4-yl)-2,8-diazaspiro[4.5]decan-1-one

ID: ALA4876828

PubChem CID: 164626826

Max Phase: Preclinical

Molecular Formula: C17H20ClN5O

Molecular Weight: 345.83

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cc(-c2cncc(Cl)c2N2CCC3(CCNC3=O)CC2)cn1

Standard InChI:  InChI=1S/C17H20ClN5O/c1-22-11-12(8-21-22)13-9-19-10-14(18)15(13)23-6-3-17(4-7-23)2-5-20-16(17)24/h8-11H,2-7H2,1H3,(H,20,24)

Standard InChI Key:  VNKGJXJKANXRKH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   11.8614  -17.9883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5672  -17.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3928  -16.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5792  -16.6959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2509  -17.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1586  -20.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1575  -21.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8655  -22.0751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5752  -21.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5723  -20.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8637  -20.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4508  -20.4382    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.8613  -19.6205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5680  -19.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5675  -18.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1521  -18.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1509  -19.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4525  -17.6190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2785  -20.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0259  -20.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5704  -20.1494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1591  -19.4432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3605  -19.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3834  -20.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  6 12  1  0
 11 13  1  0
 13 14  1  0
 13 17  1  0
 14 15  1  0
 15  1  1  0
  1 16  1  0
 16 17  1  0
  5 18  2  0
 10 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
 21 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4876828

    ---

Associated Targets(Human)

CDK8 Tchem CDK8/Cyclin C (1054 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.83Molecular Weight (Monoisotopic): 345.1356AlogP: 2.24#Rotatable Bonds: 2
Polar Surface Area: 63.05Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.80CX Basic pKa: 6.53CX LogP: 1.12CX LogD: 1.07
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.91Np Likeness Score: -1.09

References

1. Yu M, Long Y, Yang Y, Li M, Teo T, Noll B, Philip S, Wang S..  (2021)  Discovery of a potent, highly selective, and orally bioavailable inhibitor of CDK8 through a structure-based optimisation.,  218  [PMID:33823391] [10.1016/j.ejmech.2021.113391]

Source