The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(5-methyl-4-(4-(trifluoromethyl)phenyl)thiazol-2-ylamino)-N-(3-oxo-1-phenylbutan-2-yl)benzamide ID: ALA4876881
PubChem CID: 164628000
Max Phase: Preclinical
Molecular Formula: C28H24F3N3O2S
Molecular Weight: 523.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc(Nc2nc(-c3ccc(C(F)(F)F)cc3)c(C)s2)c1
Standard InChI: InChI=1S/C28H24F3N3O2S/c1-17(35)24(15-19-7-4-3-5-8-19)33-26(36)21-9-6-10-23(16-21)32-27-34-25(18(2)37-27)20-11-13-22(14-12-20)28(29,30)31/h3-14,16,24H,15H2,1-2H3,(H,32,34)(H,33,36)/t24-/m0/s1
Standard InChI Key: NSMUIVNOLCCJSQ-DEOSSOPVSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
40.0671 -31.3050 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.3573 -30.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3563 -31.7119 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.9516 -30.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9504 -30.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6626 -31.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3764 -30.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3736 -30.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6608 -29.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0889 -31.2562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7959 -30.8424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5453 -31.1724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0953 -30.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6815 -29.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8824 -30.0202 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.9072 -30.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2400 -31.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0562 -31.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5404 -30.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2028 -30.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3876 -29.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0167 -29.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6584 -28.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3690 -28.3764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9453 -28.3806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9429 -27.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2298 -27.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2274 -26.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5192 -27.5635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8401 -30.2285 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.6535 -27.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6511 -26.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3610 -25.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3589 -25.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6453 -24.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9323 -25.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9379 -25.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
13 16 1 0
14 22 1 0
19 2 1 0
9 23 1 0
23 24 2 0
23 25 1 0
26 25 1 6
26 27 1 0
27 28 1 0
27 29 2 0
2 30 1 0
26 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.58Molecular Weight (Monoisotopic): 523.1541AlogP: 6.81#Rotatable Bonds: 8Polar Surface Area: 71.09Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.34CX Basic pKa: 2.83CX LogP: 7.42CX LogD: 7.42Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -1.41
References 1. Zhang Y, Liu J, Wu X, Yang S, Li Y, Liu S, Zhu S, Cao X, Xie Z, Lei X, Huang H, Peng J.. (2021) Anti-chronic myeloid leukemia activity and quantitative structure-activity relationship of novel thiazole aminobenzamide derivatives., 44 [PMID:34015503 ] [10.1016/j.bmcl.2021.128116 ]