The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(5-(4-(4-(3,5-difluoro-2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)pentyl)-1H-indole-5-carbonitrile ID: ALA4876897
PubChem CID: 164628896
Max Phase: Preclinical
Molecular Formula: C29H30FN5O
Molecular Weight: 483.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc2[nH]cc(CCCCCN3CCN(c4ccc(-n5cc(F)ccc5=O)cc4)CC3)c2c1
Standard InChI: InChI=1S/C29H30FN5O/c30-24-6-12-29(36)35(21-24)26-9-7-25(8-10-26)34-16-14-33(15-17-34)13-3-1-2-4-23-20-32-28-11-5-22(19-31)18-27(23)28/h5-12,18,20-21,32H,1-4,13-17H2
Standard InChI Key: STLRJMYMVOSCSR-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
5.7770 -18.6616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5243 -18.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4403 -17.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6419 -17.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2333 -16.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4161 -16.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0075 -17.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4161 -18.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2333 -18.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0075 -15.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5989 -15.2229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0468 -16.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8240 -17.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4305 -16.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2077 -16.9263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8183 -16.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5914 -16.6331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7621 -17.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5394 -17.6862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1500 -17.1384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9792 -16.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2020 -16.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9231 -17.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0938 -18.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8711 -18.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4817 -17.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3109 -17.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5337 -16.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8612 -17.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6426 -17.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8133 -18.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2027 -19.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4255 -18.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2548 -18.1488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6946 -16.8025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3709 -20.0015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 3 0
6 10 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 1 0
29 35 2 0
26 34 1 0
20 23 1 0
16 17 1 0
3 12 1 0
32 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.59Molecular Weight (Monoisotopic): 483.2434AlogP: 4.86#Rotatable Bonds: 8Polar Surface Area: 68.06Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.47CX LogP: 5.20CX LogD: 4.10Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.26
References 1. Xu T, Xue Y, Lu J, Jin C.. (2021) Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs., 223 [PMID:34182358 ] [10.1016/j.ejmech.2021.113644 ]