The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-tert-butyl-N-(2-fluoro-4-(2-(1-methyl-1H-pyrazol-4-yl)-3H-imidazo[4,5-b]pyridin-7-yl)benzyl)cyclohexanecarboxamide ID: ALA4876918
PubChem CID: 121249963
Max Phase: Preclinical
Molecular Formula: C28H33FN6O
Molecular Weight: 488.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(-c2nc3c(-c4ccc(CNC(=O)C5CCC(C(C)(C)C)CC5)c(F)c4)ccnc3[nH]2)cn1
Standard InChI: InChI=1S/C28H33FN6O/c1-28(2,3)21-9-7-17(8-10-21)27(36)31-14-19-6-5-18(13-23(19)29)22-11-12-30-26-24(22)33-25(34-26)20-15-32-35(4)16-20/h5-6,11-13,15-17,21H,7-10,14H2,1-4H3,(H,31,36)(H,30,33,34)
Standard InChI Key: UHPUEKMMMVHFPJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
8.8447 -3.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5545 -3.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5534 -2.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3227 -7.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3216 -8.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0296 -8.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7393 -8.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7364 -7.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0278 -7.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0313 -9.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3219 -10.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3213 -10.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0294 -11.3209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7367 -10.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7440 -10.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5215 -11.1532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9948 -10.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5097 -9.8343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8120 -10.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3007 -11.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0756 -10.8770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0682 -10.0598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2888 -9.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7250 -9.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4426 -7.2287 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.0254 -6.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7319 -6.0068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7294 -5.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4359 -4.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0205 -4.7832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1435 -5.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8479 -4.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8497 -3.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1409 -3.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4304 -3.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2651 -3.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 15 1 0
14 10 1 0
6 10 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
22 24 1 0
8 25 1 0
9 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
29 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 2 1 0
2 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.61Molecular Weight (Monoisotopic): 488.2700AlogP: 5.63#Rotatable Bonds: 5Polar Surface Area: 88.49Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.37CX Basic pKa: 1.96CX LogP: 5.03CX LogD: 5.03Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -1.59
References 1. Qiu H, Ali Z, Bender A, Caldwell R, Chen YY, Fang Z, Gardberg A, Glaser N, Goettsche A, Goutopoulos A, Grenningloh R, Hanschke B, Head J, Johnson T, Jones C, Jones R, Kulkarni S, Maurer C, Morandi F, Neagu C, Poetzsch S, Potnick J, Schmidt R, Roe K, Viacava Follis A, Wing C, Zhu X, Sherer B.. (2021) Discovery of potent and selective reversible Bruton's tyrosine kinase inhibitors., 40 [PMID:33932711 ] [10.1016/j.bmc.2021.116163 ]