The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-((4-(Furan-2-ylmethyl)piperazin-1-yl)methyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one ID: ALA4876922
PubChem CID: 164629136
Max Phase: Preclinical
Molecular Formula: C25H24N2O6
Molecular Weight: 448.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1cc(-c2ccc(O)cc2)oc2c(CN3CCN(Cc4ccco4)CC3)c(O)cc(O)c12
Standard InChI: InChI=1S/C25H24N2O6/c28-17-5-3-16(4-6-17)23-13-22(31)24-21(30)12-20(29)19(25(24)33-23)15-27-9-7-26(8-10-27)14-18-2-1-11-32-18/h1-6,11-13,28-30H,7-10,14-15H2
Standard InChI Key: DMAWEGWCFGENSW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
5.1234 -20.2782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1221 -21.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8370 -21.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8352 -19.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5505 -20.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5493 -21.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2661 -21.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9887 -21.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9900 -20.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2686 -19.8567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4088 -19.8659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8367 -22.3433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2638 -22.3478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8326 -19.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1170 -18.6302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1172 -17.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4056 -17.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6900 -17.8025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6905 -18.6284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4066 -19.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9758 -17.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2611 -17.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7037 -19.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4174 -20.2844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1323 -19.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1349 -19.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4164 -18.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7044 -19.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8498 -18.6368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5097 -17.4687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9572 -18.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3691 -18.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1761 -18.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
1 11 1 0
3 12 1 0
7 13 2 0
4 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
9 23 1 0
26 29 1 0
22 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 22 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.48Molecular Weight (Monoisotopic): 448.1634AlogP: 3.49#Rotatable Bonds: 5Polar Surface Area: 110.52Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.51CX Basic pKa: 6.49CX LogP: 2.48CX LogD: 1.73Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: 0.17
References 1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H.. (2021) Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer., 64 (16.0): [PMID:34404206 ] [10.1021/acs.jmedchem.1c00735 ]