The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 3-O-((3-carboxyphenyl)-1,2,3-triazol-4-ylmethyl)-beta-D-galactopyranoside ID: ALA4877004
PubChem CID: 164627055
Max Phase: Preclinical
Molecular Formula: C17H21N3O8
Molecular Weight: 395.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OCc2cn(-c3cccc(C(=O)O)c3)nn2)[C@H]1O
Standard InChI: InChI=1S/C17H21N3O8/c1-26-17-14(23)15(13(22)12(7-21)28-17)27-8-10-6-20(19-18-10)11-4-2-3-9(5-11)16(24)25/h2-6,12-15,17,21-23H,7-8H2,1H3,(H,24,25)/t12-,13+,14-,15+,17-/m1/s1
Standard InChI Key: VOUCYDITYYHOIP-LBKYZSNHSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
41.7006 -3.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7006 -4.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4127 -4.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1247 -4.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1247 -3.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4127 -3.0584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4127 -5.5335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9868 -4.7136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.8404 -3.0647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9849 -3.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9825 -2.2396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.8386 -4.7136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.5537 -3.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6982 -5.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6982 -6.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0350 -7.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2899 -8.0430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1150 -8.0430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.3698 -7.2584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8073 -8.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9858 -8.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5011 -9.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8366 -10.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6616 -10.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1426 -9.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9998 -10.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5172 -11.5484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8206 -10.9626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 1
2 8 1 1
5 9 1 1
1 10 1 1
10 11 1 0
4 12 1 6
9 13 1 0
7 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
24 26 1 0
26 27 1 0
26 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.37Molecular Weight (Monoisotopic): 395.1329AlogP: -1.06#Rotatable Bonds: 7Polar Surface Area: 156.39Molecular Species: ACIDHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.93CX Basic pKa: ┄CX LogP: -0.48CX LogD: -3.68Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.46Np Likeness Score: 0.14
References 1. Hassan M, van Klaveren S, Håkansson M, Diehl C, Kovačič R, Baussière F, Sundin AP, Dernovšek J, Walse B, Zetterberg F, Leffler H, Anderluh M, Tomašič T, Jakopin Ž, Nilsson UJ.. (2021) Benzimidazole-galactosides bind selectively to the Galectin-8 N-Terminal domain: Structure-based design and optimisation., 223 [PMID:34225180 ] [10.1016/j.ejmech.2021.113664 ]