(4-(3-(1H-Benzo[d]imidazol-6-yl)-5-(piperidin-4-ylmethoxy)pyrazin-2-yl)phenyl)methanamine

ID: ALA4877029

PubChem CID: 164627718

Max Phase: Preclinical

Molecular Formula: C24H26N6O

Molecular Weight: 414.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCc1ccc(-c2ncc(OCC3CCNCC3)nc2-c2ccc3nc[nH]c3c2)cc1

Standard InChI:  InChI=1S/C24H26N6O/c25-12-16-1-3-18(4-2-16)23-24(19-5-6-20-21(11-19)29-15-28-20)30-22(13-27-23)31-14-17-7-9-26-10-8-17/h1-6,11,13,15,17,26H,7-10,12,14,25H2,(H,28,29)

Standard InChI Key:  MFNVTBUSEWVSOB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   30.4163   -2.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4151   -3.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1232   -3.6511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8328   -3.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8300   -2.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1214   -2.0138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5412   -3.6492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2482   -3.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9566   -3.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6636   -3.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9579   -4.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3720   -3.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3733   -4.4619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6662   -4.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7090   -3.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7105   -2.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7117   -1.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0047   -0.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2961   -1.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2989   -2.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0065   -2.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5878   -0.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8807   -1.1988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0051   -3.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0112   -4.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7139   -4.4616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2995   -4.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3002   -3.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5271   -3.3994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0486   -4.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5261   -4.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 11 14  1  0
 12 13  1  0
 13 14  1  0
  2 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  1 16  1  0
 19 22  1  0
 22 23  1  0
 15 24  2  0
 24 28  1  0
 27 25  1  0
 25 26  2  0
 26 15  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877029

    ---

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.51Molecular Weight (Monoisotopic): 414.2168AlogP: 3.52#Rotatable Bonds: 6
Polar Surface Area: 101.74Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.93CX Basic pKa: 10.37CX LogP: 2.42CX LogD: -2.01
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -0.76

References

1. Nie S, Yao Y, Wu F, Wu X, Zhao J, Hua Y, Wu J, Huo T, Lin YL, Kneubehl AR, Vogt MB, Ferreon J, Rico-Hesse R, Song Y..  (2021)  Synthesis, Structure-Activity Relationships, and Antiviral Activity of Allosteric Inhibitors of Flavivirus NS2B-NS3 Protease.,  64  (5.0): [PMID:33596380] [10.1021/acs.jmedchem.0c02070]

Source