The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(7-(trans-4-Hydroxycyclohexyl)-2-(((S)-pentan-2-yl)amino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl)piperidin-1-yl)(1-methylpiperidin-4-yl)methanone ID: ALA4877058
PubChem CID: 146402932
Max Phase: Preclinical
Molecular Formula: C29H46N6O2
Molecular Weight: 510.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@H](C)Nc1ncc2c(C3CCN(C(=O)C4CCN(C)CC4)CC3)cn([C@H]3CC[C@H](O)CC3)c2n1
Standard InChI: InChI=1S/C29H46N6O2/c1-4-5-20(2)31-29-30-18-25-26(19-35(27(25)32-29)23-6-8-24(36)9-7-23)21-12-16-34(17-13-21)28(37)22-10-14-33(3)15-11-22/h18-24,36H,4-17H2,1-3H3,(H,30,31,32)/t20-,23-,24-/m0/s1
Standard InChI Key: UGODXHKPBLIJKJ-OYDLWJJNSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
12.2688 -26.7361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2677 -27.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9757 -27.9647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9739 -26.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6826 -26.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6828 -27.5512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4615 -27.8039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9425 -27.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4610 -26.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7142 -28.5811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1680 -29.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4178 -29.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2166 -30.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7653 -29.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5152 -28.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4664 -30.9103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5597 -27.9637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8523 -27.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1442 -27.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4369 -27.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7288 -27.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8529 -26.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7166 -25.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5172 -25.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7702 -24.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2261 -24.1538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4255 -24.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1690 -25.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4813 -23.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2812 -23.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9366 -22.7683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8202 -23.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6170 -23.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8763 -22.8818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3324 -22.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5292 -22.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6768 -22.7177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 7 1 1
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 6
2 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
18 22 1 6
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
9 23 1 0
26 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
30 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.73Molecular Weight (Monoisotopic): 510.3682AlogP: 4.56#Rotatable Bonds: 7Polar Surface Area: 86.52Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.79CX LogP: 3.25CX LogD: 1.83Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.57Np Likeness Score: -0.83
References 1. Zheng H, Zhao J, Li B, Zhang W, Stashko MA, Minson KA, Huey MG, Zhou Y, Earp HS, Kireev D, Graham DK, DeRyckere D, Frye SV, Wang X.. (2021) UNC5293, a potent, orally available and highly MERTK-selective inhibitor., 220 [PMID:34038857 ] [10.1016/j.ejmech.2021.113534 ]