The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-cyclohexyl-7-(3-methyl-2H-indazol-6-yl)-2-phenethylimidazo[1,2-a]pyridin-3-amine ID: ALA4877061
PubChem CID: 164628006
Max Phase: Preclinical
Molecular Formula: C29H31N5
Molecular Weight: 449.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]nc2cc(-c3ccn4c(NC5CCCCC5)c(CCc5ccccc5)nc4c3)ccc12
Standard InChI: InChI=1S/C29H31N5/c1-20-25-14-13-22(18-27(25)33-32-20)23-16-17-34-28(19-23)31-26(15-12-21-8-4-2-5-9-21)29(34)30-24-10-6-3-7-11-24/h2,4-5,8-9,13-14,16-19,24,30H,3,6-7,10-12,15H2,1H3,(H,32,33)
Standard InChI Key: JBADSYAFZBXNCZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
31.9693 -24.9155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5206 -25.9656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5198 -26.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2279 -27.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2256 -25.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9344 -25.9615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9394 -26.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7195 -27.0283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1967 -26.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7114 -25.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0119 -26.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4253 -27.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2425 -27.0567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6537 -27.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4701 -27.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8746 -27.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4568 -26.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6418 -26.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4238 -24.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6829 -23.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1412 -22.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3403 -23.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0840 -23.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6285 -24.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8152 -27.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1074 -26.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1117 -28.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8162 -28.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3973 -28.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4038 -27.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6258 -26.9323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1385 -27.5920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6154 -28.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3568 -29.0344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 7 1 0
6 5 1 0
5 2 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 6 1 0
10 1 1 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
1 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
25 26 2 0
26 30 1 0
29 27 1 0
27 28 2 0
28 25 1 0
3 25 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 1 0
33 29 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.60Molecular Weight (Monoisotopic): 449.2579AlogP: 6.72#Rotatable Bonds: 6Polar Surface Area: 58.01Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.75CX Basic pKa: 7.22CX LogP: 6.06CX LogD: 5.85Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -0.90
References 1. Muthengi A, Wimalasena VK, Yosief HO, Bikowitz MJ, Sigua LH, Wang T, Li D, Gaieb Z, Dhawan G, Liu S, Erickson J, Amaro RE, Schönbrunn E, Qi J, Zhang W.. (2021) Development of Dimethylisoxazole-Attached Imidazo[1,2-a ]pyridines as Potent and Selective CBP/P300 Inhibitors., 64 (9.0): [PMID:33872011 ] [10.1021/acs.jmedchem.0c02232 ]