6-(2-amino-5-(4-ethynyl-2-fluoro-5-nitrophenyl)pyridin-3-yl)-3,4-dihydroisoquinolin-1(2H)-one

ID: ALA4877076

PubChem CID: 122588179

Max Phase: Preclinical

Molecular Formula: C22H15FN4O3

Molecular Weight: 402.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C#Cc1cc(F)c(-c2cnc(N)c(-c3ccc4c(c3)CCNC4=O)c2)cc1[N+](=O)[O-]

Standard InChI:  InChI=1S/C22H15FN4O3/c1-2-12-9-19(23)17(10-20(12)27(29)30)15-8-18(21(24)26-11-15)13-3-4-16-14(7-13)5-6-25-22(16)28/h1,3-4,7-11H,5-6H2,(H2,24,26)(H,25,28)

Standard InChI Key:  OQBHWBCOYXYZGP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    8.5103  -10.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0876  -10.7171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3801  -10.3082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0872  -11.5343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7958  -10.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2238  -10.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5092   -9.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7999   -9.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2187   -9.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5057   -8.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0388   -4.5687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9287   -5.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6367   -5.3900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6393   -7.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9287   -6.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2165   -7.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5082   -6.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8037   -7.0326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8037   -7.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2165   -7.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5082   -5.8022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3371   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3452   -6.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0573   -7.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7660   -6.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7579   -5.7762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0412   -5.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9240   -9.0712    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.5175  -11.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5247  -12.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  2  1  0
  2  3  1  0
  2  4  2  0
  7 10  1  0
  7  8  2  0
  8  5  1  0
  5  1  2  0
  9  7  1  0
  9  6  2  0
  6  1  1  0
 27 11  2  0
 13 12  2  0
 22 13  1  0
 14 23  1  0
 15 14  2  0
 12 15  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 10 19  1  0
 20 10  2  0
 16 20  1  0
 17 21  1  0
 22 23  2  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  9 28  1  0
  1 29  1  0
 29 30  3  0
M  CHG  2   2   1   3  -1
M  END

Alternative Forms

  1. Parent:

    ALA4877076

    ---

Associated Targets(Human)

STK4 Tchem Serine/threonine-protein kinase MST1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.39Molecular Weight (Monoisotopic): 402.1128AlogP: 3.31#Rotatable Bonds: 3
Polar Surface Area: 111.15Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.81CX LogP: 3.16CX LogD: 3.15
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -0.42

References

1.  (2020)  STK4 inhibitors for treatment of hematologic malignancies, 

Source