The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(2-amino-5-(4-ethynyl-2-fluoro-5-nitrophenyl)pyridin-3-yl)-3,4-dihydroisoquinolin-1(2H)-one ID: ALA4877076
PubChem CID: 122588179
Max Phase: Preclinical
Molecular Formula: C22H15FN4O3
Molecular Weight: 402.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C#Cc1cc(F)c(-c2cnc(N)c(-c3ccc4c(c3)CCNC4=O)c2)cc1[N+](=O)[O-]
Standard InChI: InChI=1S/C22H15FN4O3/c1-2-12-9-19(23)17(10-20(12)27(29)30)15-8-18(21(24)26-11-15)13-3-4-16-14(7-13)5-6-25-22(16)28/h1,3-4,7-11H,5-6H2,(H2,24,26)(H,25,28)
Standard InChI Key: OQBHWBCOYXYZGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
8.5103 -10.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0876 -10.7171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3801 -10.3082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0872 -11.5343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7958 -10.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2238 -10.2897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5092 -9.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 -9.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2187 -9.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5057 -8.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0388 -4.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9287 -5.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6367 -5.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6393 -7.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9287 -6.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2165 -7.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5082 -6.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8037 -7.0326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8037 -7.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2165 -7.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5082 -5.8022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3371 -5.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3452 -6.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0573 -7.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7660 -6.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7579 -5.7762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0412 -5.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9240 -9.0712 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5175 -11.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5247 -12.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
2 3 1 0
2 4 2 0
7 10 1 0
7 8 2 0
8 5 1 0
5 1 2 0
9 7 1 0
9 6 2 0
6 1 1 0
27 11 2 0
13 12 2 0
22 13 1 0
14 23 1 0
15 14 2 0
12 15 1 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
10 19 1 0
20 10 2 0
16 20 1 0
17 21 1 0
22 23 2 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
9 28 1 0
1 29 1 0
29 30 3 0
M CHG 2 2 1 3 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.39Molecular Weight (Monoisotopic): 402.1128AlogP: 3.31#Rotatable Bonds: 3Polar Surface Area: 111.15Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.81CX LogP: 3.16CX LogD: 3.15Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -0.42
References 1. (2020) STK4 inhibitors for treatment of hematologic malignancies,