(S)-1-(2-hydroxy-4-(3-(2-methoxyphenoxy)-2-methylpropoxy)-3-methylphenyl)-3,3-dimethylbutan-1-one

ID: ALA4877085

PubChem CID: 164628707

Max Phase: Preclinical

Molecular Formula: C24H32O5

Molecular Weight: 400.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1OC[C@H](C)COc1ccc(C(=O)CC(C)(C)C)c(O)c1C

Standard InChI:  InChI=1S/C24H32O5/c1-16(15-29-22-10-8-7-9-21(22)27-6)14-28-20-12-11-18(23(26)17(20)2)19(25)13-24(3,4)5/h7-12,16,26H,13-15H2,1-6H3/t16-/m1/s1

Standard InChI Key:  BNBLXAFUTSZRNS-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
    8.1457  -27.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1446  -28.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8526  -28.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5623  -28.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5595  -27.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8508  -27.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4379  -27.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8484  -26.4057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2656  -27.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9749  -27.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2625  -26.3997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6810  -27.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3903  -27.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6780  -26.3944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3858  -26.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4366  -28.8593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7292  -28.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0211  -28.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3138  -28.4491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6057  -28.8571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8983  -28.4479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9040  -27.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1974  -27.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1975  -28.8586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0205  -29.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4904  -28.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4840  -27.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6133  -27.2270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3194  -27.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  6  8  1  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 12 15  1  0
  2 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 27  2  0
 26 24  2  0
 24 21  1  0
 18 25  1  1
 26 27  1  0
 22 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877085

    ---

Associated Targets(non-human)

Grm3 Metabotropic glutamate receptor 3 (981 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Grm2 Metabotropic glutamate receptor 2 (1326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.52Molecular Weight (Monoisotopic): 400.2250AlogP: 5.42#Rotatable Bonds: 9
Polar Surface Area: 64.99Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.47CX Basic pKa: CX LogP: 5.99CX LogD: 5.99
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.57Np Likeness Score: 0.01

References

1. Yamada Y, Gilliland K, Xiang Z, Haymer D, Crocker KE, Loch MT, Schulte ML, Rodriguez AL, Niswender CM, Jeffrey Conn P, Lindsley CW, Melancon BJ..  (2021)  Positive allosteric modulators (PAMs) of the group II metabotropic glutamate receptors: Design, synthesis, and evaluation as ex-vivo tool compounds.,  50  [PMID:34461178] [10.1016/j.bmcl.2021.128342]

Source