The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-amino-2-(1-(but-2-ynoyl)piperidin-2-yl)-4-(4-((5-fluoro-4-methylpyridin-2-yl)carbamoyl)phenyl)-1H-imidazole-5-carboxamide ID: ALA4877159
PubChem CID: 155286727
Max Phase: Preclinical
Molecular Formula: C26H26FN7O3
Molecular Weight: 503.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC#CC(=O)N1CCCC[C@H]1c1nc(-c2ccc(C(=O)Nc3cc(C)c(F)cn3)cc2)c(C(N)=O)n1N
Standard InChI: InChI=1S/C26H26FN7O3/c1-3-6-21(35)33-12-5-4-7-19(33)25-32-22(23(24(28)36)34(25)29)16-8-10-17(11-9-16)26(37)31-20-13-15(2)18(27)14-30-20/h8-11,13-14,19H,4-5,7,12,29H2,1-2H3,(H2,28,36)(H,30,31,37)/t19-/m0/s1
Standard InChI Key: VHUWNCIMWYRTIU-IBGZPJMESA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
2.8070 -30.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6295 -30.3520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8011 -29.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0814 -29.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4675 -29.6865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5556 -29.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2264 -29.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9824 -29.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0693 -28.5425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3938 -28.0563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6407 -28.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8230 -28.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9514 -27.3933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4609 -28.7247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6600 -29.5138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9943 -28.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6625 -27.8214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2402 -27.9700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6341 -31.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0449 -31.1541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8091 -31.8700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3924 -31.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5685 -31.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1548 -31.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5673 -32.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3975 -32.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0479 -32.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4602 -33.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8726 -34.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2291 -28.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8656 -28.9490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6333 -28.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7626 -27.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1181 -27.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3530 -27.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2440 -26.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5304 -27.5453 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 6 1 0
9 12 1 0
12 13 2 0
12 14 1 0
5 15 1 0
4 16 1 0
16 17 1 0
16 18 2 0
22 1 1 1
21 19 1 0
19 20 2 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 28 3 0
19 27 1 0
28 29 1 0
14 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
34 36 1 0
33 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.54Molecular Weight (Monoisotopic): 503.2081AlogP: 2.53#Rotatable Bonds: 5Polar Surface Area: 149.23Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.68CX LogP: 3.01CX LogD: 3.01Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.18
References 1. Ma C, Li Q, Zhao M, Fan G, Zhao J, Zhang D, Yang S, Zhang S, Gao D, Mao L, Zhu L, Li W, Xu G, Jiang Y, Ding Q.. (2021) Discovery of 1-Amino-1H -imidazole-5-carboxamide Derivatives as Highly Selective, Covalent Bruton's Tyrosine Kinase (BTK) Inhibitors., 64 (21.0): [PMID:34672559 ] [10.1021/acs.jmedchem.1c01559 ]