(S)-1-amino-2-(1-(but-2-ynoyl)piperidin-2-yl)-4-(4-((5-fluoro-4-methylpyridin-2-yl)carbamoyl)phenyl)-1H-imidazole-5-carboxamide

ID: ALA4877159

PubChem CID: 155286727

Max Phase: Preclinical

Molecular Formula: C26H26FN7O3

Molecular Weight: 503.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC#CC(=O)N1CCCC[C@H]1c1nc(-c2ccc(C(=O)Nc3cc(C)c(F)cn3)cc2)c(C(N)=O)n1N

Standard InChI:  InChI=1S/C26H26FN7O3/c1-3-6-21(35)33-12-5-4-7-19(33)25-32-22(23(24(28)36)34(25)29)16-8-10-17(11-9-16)26(37)31-20-13-15(2)18(27)14-30-20/h8-11,13-14,19H,4-5,7,12,29H2,1-2H3,(H2,28,36)(H,30,31,37)/t19-/m0/s1

Standard InChI Key:  VHUWNCIMWYRTIU-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    2.8070  -30.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6295  -30.3520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8011  -29.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0814  -29.1284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4675  -29.6865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5556  -29.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2264  -29.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9824  -29.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0693  -28.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3938  -28.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6407  -28.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8230  -28.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9514  -27.3933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4609  -28.7247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6600  -29.5138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9943  -28.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6625  -27.8214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2402  -27.9700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6341  -31.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0449  -31.1541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8091  -31.8700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3924  -31.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5685  -31.1534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1548  -31.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5673  -32.5880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3975  -32.5894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0479  -32.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4602  -33.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8726  -34.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2291  -28.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8656  -28.9490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6333  -28.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7626  -27.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1181  -27.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3530  -27.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2440  -26.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5304  -27.5453    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3  6  1  0
  9 12  1  0
 12 13  2  0
 12 14  1  0
  5 15  1  0
  4 16  1  0
 16 17  1  0
 16 18  2  0
 22  1  1  1
 21 19  1  0
 19 20  2  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 28  3  0
 19 27  1  0
 28 29  1  0
 14 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 34 36  1  0
 33 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877159

    ---

Associated Targets(Human)

BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.54Molecular Weight (Monoisotopic): 503.2081AlogP: 2.53#Rotatable Bonds: 5
Polar Surface Area: 149.23Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.68CX LogP: 3.01CX LogD: 3.01
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.18

References

1. Ma C, Li Q, Zhao M, Fan G, Zhao J, Zhang D, Yang S, Zhang S, Gao D, Mao L, Zhu L, Li W, Xu G, Jiang Y, Ding Q..  (2021)  Discovery of 1-Amino-1H-imidazole-5-carboxamide Derivatives as Highly Selective, Covalent Bruton's Tyrosine Kinase (BTK) Inhibitors.,  64  (21.0): [PMID:34672559] [10.1021/acs.jmedchem.1c01559]

Source