The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3,5-Dimethylisoxazol-4-yl)-1-methyl-4-phenyl-3-((2-phenylthiazol-4-yl)methyl)-3,4-dihydroquinazolin-2(1H)-one ID: ALA4877162
PubChem CID: 164625994
Max Phase: Preclinical
Molecular Formula: C30H26N4O2S
Molecular Weight: 506.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(C)c1-c1ccc2c(c1)C(c1ccccc1)N(Cc1csc(-c3ccccc3)n1)C(=O)N2C
Standard InChI: InChI=1S/C30H26N4O2S/c1-19-27(20(2)36-32-19)23-14-15-26-25(16-23)28(21-10-6-4-7-11-21)34(30(35)33(26)3)17-24-18-37-29(31-24)22-12-8-5-9-13-22/h4-16,18,28H,17H2,1-3H3
Standard InChI Key: LQSGAGVAHHBISN-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
36.8176 -18.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8164 -19.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5245 -19.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5227 -17.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2313 -18.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2301 -19.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9402 -19.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6561 -19.1031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6573 -18.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9426 -17.8620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9390 -20.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2285 -20.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2259 -21.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9330 -21.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6442 -21.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6433 -20.7332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3626 -19.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0715 -19.1071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8147 -19.4429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.3632 -18.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9566 -18.1282 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.1568 -18.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1731 -18.9243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5026 -19.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3143 -19.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7973 -19.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4629 -18.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6522 -18.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9426 -17.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3660 -17.8710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1088 -19.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3625 -19.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8152 -19.7782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2233 -20.4863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0227 -20.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1932 -18.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6296 -20.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 11 1 0
8 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
20 23 1 0
10 29 1 0
9 30 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
35 31 2 0
2 31 1 0
32 36 1 0
35 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.63Molecular Weight (Monoisotopic): 506.1776AlogP: 7.24#Rotatable Bonds: 5Polar Surface Area: 62.47Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.03CX LogP: 5.56CX LogD: 5.56Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -1.29
References 1. Fang L, Hu Z, Yang Y, Chen P, Zhou J, Zhang H.. (2021) Discovery of 3,5-dimethylisoxazole derivatives as novel, potent inhibitors for bromodomain and extraterminal domain (BET) family., 39 [PMID:33862375 ] [10.1016/j.bmc.2021.116133 ]