The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(Benzylthio)-N-(5,6-dihydroxybenzo[d]thiazol-2-yl)-2-(4-methylphenylsulfonamido)propionamide ID: ALA4877173
PubChem CID: 164626001
Max Phase: Preclinical
Molecular Formula: C24H23N3O5S3
Molecular Weight: 529.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)N[C@@H](CSCc2ccccc2)C(=O)Nc2nc3cc(O)c(O)cc3s2)cc1
Standard InChI: InChI=1S/C24H23N3O5S3/c1-15-7-9-17(10-8-15)35(31,32)27-19(14-33-13-16-5-3-2-4-6-16)23(30)26-24-25-18-11-20(28)21(29)12-22(18)34-24/h2-12,19,27-29H,13-14H2,1H3,(H,25,26,30)/t19-/m0/s1
Standard InChI Key: ORWVNLYNIYIKKX-IBGZPJMESA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
34.1205 -11.1541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1246 -11.9791 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.8370 -11.5629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1274 -11.5748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1263 -12.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8411 -12.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8393 -11.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5546 -11.5712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5549 -12.3976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3410 -12.6528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8267 -11.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3406 -11.3157 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.4129 -11.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4115 -12.8142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6517 -11.9837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0639 -11.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8889 -11.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6512 -10.5548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3016 -11.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5394 -12.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1229 -13.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5350 -14.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3609 -14.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7730 -13.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3585 -12.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7747 -14.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3011 -10.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8884 -9.8398 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.3006 -9.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8879 -8.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3023 -7.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8902 -6.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0643 -6.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6522 -7.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0667 -8.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
4 13 1 0
5 14 1 0
11 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 2 1 0
2 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
17 27 1 6
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.67Molecular Weight (Monoisotopic): 529.0800AlogP: 4.23#Rotatable Bonds: 9Polar Surface Area: 128.62Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.61CX Basic pKa: 0.16CX LogP: 5.07CX LogD: 4.86Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.46
References 1. Maus H, Barthels F, Hammerschmidt SJ, Kopp K, Millies B, Gellert A, Ruggieri A, Schirmeister T.. (2021) SAR of novel benzothiazoles targeting an allosteric pocket of DENV and ZIKV NS2B/NS3 proteases., 47 [PMID:34509861 ] [10.1016/j.bmc.2021.116392 ]