The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-fluoro-6-(2-hydroxypropan-2-yl)pyridin-2-yl)-2-isopropyl-6-((1,2,3,4-tetrahydroisoquinolin-7-yl)amino)-1,2-dihydro-3H-pyrazolo[3,4-d]pyrimidin-3-one ID: ALA4877216
PubChem CID: 155191047
Max Phase: Preclinical
Molecular Formula: C25H28FN7O2
Molecular Weight: 477.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)n1c(=O)c2cnc(Nc3ccc4c(c3)CNCC4)nc2n1-c1ccc(F)c(C(C)(C)O)n1
Standard InChI: InChI=1S/C25H28FN7O2/c1-14(2)32-23(34)18-13-28-24(29-17-6-5-15-9-10-27-12-16(15)11-17)31-22(18)33(32)20-8-7-19(26)21(30-20)25(3,4)35/h5-8,11,13-14,27,35H,9-10,12H2,1-4H3,(H,28,29,31)
Standard InChI Key: MYDBFFMSHMOUEC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
16.0960 -10.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6717 -10.0289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3081 -11.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8838 -10.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3039 -10.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3535 -7.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8974 -7.5410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6054 -7.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3137 -7.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3137 -8.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6080 -8.7664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8974 -8.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1893 -8.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4813 -8.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7730 -8.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0644 -8.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0644 -7.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7704 -7.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4813 -7.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6476 -7.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6476 -8.3656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3560 -8.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0897 -8.6013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5771 -7.9434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1116 -7.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3237 -6.5010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3018 -9.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0938 -9.6057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7238 -10.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9369 -10.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7225 -9.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3942 -7.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8086 -7.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9364 -11.7637 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.7970 -8.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 1 0
1 3 1 0
1 4 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
12 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
17 6 1 0
6 20 1 0
20 21 1 0
21 22 1 0
16 22 1 0
10 23 1 0
23 24 1 0
25 24 1 0
9 25 1 0
25 26 2 0
27 23 1 0
28 27 2 0
5 28 1 0
29 5 2 0
30 29 1 0
31 30 2 0
27 31 1 0
24 32 1 0
32 33 1 0
29 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.54Molecular Weight (Monoisotopic): 477.2289AlogP: 3.31#Rotatable Bonds: 5Polar Surface Area: 109.89Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.78CX Basic pKa: 9.03CX LogP: 2.77CX LogD: 1.13Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.01
References 1. (2020) Heterocyclic compounds and uses thereof,