1-(4-((4-(tert-Butyl)phenyl)sulfonyl)-1-(2,5-dimethoxyphenyl)-1H-1,2,3-triazol-5-yl)ethan-1-one

ID: ALA4877224

PubChem CID: 130472195

Max Phase: Preclinical

Molecular Formula: C22H25N3O5S

Molecular Weight: 443.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(OC)c(-n2nnc(S(=O)(=O)c3ccc(C(C)(C)C)cc3)c2C(C)=O)c1

Standard InChI:  InChI=1S/C22H25N3O5S/c1-14(26)20-21(31(27,28)17-10-7-15(8-11-17)22(2,3)4)23-24-25(20)18-13-16(29-5)9-12-19(18)30-6/h7-13H,1-6H3

Standard InChI Key:  MTYFTMGELMJBAZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    8.0316  -12.9347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3217  -12.5220    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3207  -13.3416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0692  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0681  -11.8475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7803  -12.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4941  -11.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4912  -11.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7785  -10.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2025  -12.2525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2893  -13.0692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0930  -13.2379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5005  -12.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9485  -11.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7801  -13.0777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0681  -13.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1213  -11.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7315  -11.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5534  -11.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9590  -11.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5475  -10.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7220  -10.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3159  -11.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9523   -9.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7736   -9.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5398   -8.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3606   -8.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7761   -9.7936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4825   -9.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8990  -10.8645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5152  -10.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  7 10  1  0
  6 15  1  0
 15 16  1  0
 14 17  1  0
 13  2  1  0
  2 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
  9 28  1  0
 28 29  1  0
 17 30  2  0
 17 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4877224

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.53Molecular Weight (Monoisotopic): 443.1515AlogP: 3.62#Rotatable Bonds: 6
Polar Surface Area: 100.38Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 13.87CX Basic pKa: CX LogP: 3.93CX LogD: 3.93
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -1.39

References

1. Li Y, Lin W, Wright WC, Chai SC, Wu J, Chen T..  (2021)  Building a Chemical Toolbox for Human Pregnane X Receptor Research: Discovery of Agonists, Inverse Agonists, and Antagonists Among Analogs Based on the Unique Chemical Scaffold of SPA70.,  64  (3.0): [PMID:33497575] [10.1021/acs.jmedchem.0c02201]

Source